
CAS Number81-58-3
SynonymsMFCD00035801; EINECS 201-362-4; 1,4,5,8-tetrachloroanthracene; 1,4,5,8-Tetrachloranthrachinon; 9,1,4,5,8-tetrachloro; 1,4,5,8-tetrachloro-anthraquinone; 1,5,8-Tetrachloroanthraquinone
Molecular FormulaC14H4O2Cl4
Molecular Weight346
Purity98.00%
Density1.672 g/cm3
Boiling Point510.7ºC at 760 mmHg
Melting Point-9ºC
AppearanceTransparent colorless liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81-58-3 |
| Catalog No. | 2A-9017350 |
| Chinese Name | 1,4,5,8-四氯蒽醌 |
| Synonyms | MFCD00035801; EINECS 201-362-4; 1,4,5,8-tetrachloroanthracene; 1,4,5,8-Tetrachloranthrachinon; 9,1,4,5,8-tetrachloro; 1,4,5,8-tetrachloro-anthraquinone; 1,5,8-Tetrachloroanthraquinone |
| Molecular Formula | C14H4O2Cl4 |
| Molecular Weight | 346 |
| Purity | 98.00 |
| Density | 1.672 g/cm3 |
| Boiling Point | 510.7ºC at 760 mmHg |
| Melting Point | -9ºC |
| Appearance | Transparent colorless liquid |
| Storage Condition | Sealed packaging in iron drums, and there should b |
| Packaging | I; II; III |
| HTC | 2914700090 |
| MDL Number | MFCD00035801 |
| SMILES | O=C1c2c(Cl)ccc(Cl)c2C(=O)c2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C14H4Cl4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H |
| InChI Key | DUJPMUKIEFLXRE-UHFFFAOYSA-N |
| MSDS | msds/17350_1_81_58_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Tannic acid | 1401-55-4 | 2A-9015839 |
| Dihydrotachysterol | 67-96-9 | 2A-9016963 |
| 1,2-Dihydroxy anthraquinone | 72-48-0 | 2A-9017031 |
| Dihydrocholesterol | 80-97-7 | 2A-9017326 |
| 1,8-Dihydroxy-4,5-dinitroanthraquinone | 81-55-0 | 2A-9017349 |
| 1-Amino-4-bromo anthraquinone | 81-62-9 | 2A-9017351 |
| 1-Chloro anthraquinone | 82-44-0 | 2A-9017369 |
| 1-Amino anthraquinone | 82-45-1 | 2A-9017370 |
| 1-Anthraquinonesulfonic acid | 82-49-5 | 2A-9017371 |
| beta-Sitosterol | 83-46-5 | 2A-9017394 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA