
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82-44-0 |
| Catalog No. | 2A-9017369 |
| Chinese Name | 1-chloroanthracene-9,10-dione |
| Synonyms | Anthraquinone,1-chloro; 9,10-Anthracenedione,1-chloro; 1-CHLOROANTHRAQUINONE; 1-Chloranthrachinon [Czech] |
| Molecular Formula | C14H7ClO2 |
| Molecular Weight | 242.66 |
| Purity | 98 |
| Melting Point | 159-160 °C (lit.) |
| Appearance | powder |
| EINECS | 201-421-4 |
| HTC | 2914700090 |
| PubChem ID | 24892317 |
| MDL Number | MFCD00001189 |
| SMILES | Clc1cccc2C(=O)c3ccccc3C(=O)c12 |
| InChI | 1S/C14H7ClO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H |
| InChI Key | BOCJQSFSGAZAPQ-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/17369_1_82_44_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| 1,2-Dihydroxy anthraquinone | 72-48-0 | 2A-9017031 |
| Dihydrocholesterol | 80-97-7 | 2A-9017326 |
| 1,8-Dihydroxy-4,5-dinitroanthraquinone | 81-55-0 | 2A-9017349 |
| 1,4,5,8-Tetrachloroanthraquinone | 81-58-3 | 2A-9017350 |
| 1-Amino-4-bromo anthraquinone | 81-62-9 | 2A-9017351 |
| 1-Amino anthraquinone | 82-45-1 | 2A-9017370 |
| 1-Anthraquinonesulfonic acid | 82-49-5 | 2A-9017371 |
| beta-Sitosterol | 83-46-5 | 2A-9017394 |
| 2-tert-Butylanthraquinone | 84-47-9 | 2A-9017411 |
| 2-Anthraquinonesulfonic acid | 84-48-0 | 2A-9017412 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA