
CAS Number81-62-9
Synonyms1-Amino-4-brom-anthrachinon; 1-amino-4-bromo-9,10-anthracenedione; 4-bromo-1-aminoanthraquinone; 1-amino-4-bromo-anthraquinone; 1-amino-4-bromo-9,10-anthraquinone; MFCD00156864; 9,10-Anthracenedione,1-amino-4-bromo
Molecular FormulaC21H12BrNO3
Molecular Weight406.239
Purity98.00%
Density1.701 g/cm3
Boiling Point512.2ºC at 760 mmHg
Melting Point14ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81-62-9 |
| Catalog No. | 2A-9017351 |
| Chinese Name | 1-氨基-4-溴蒽醌 |
| Synonyms | 1-Amino-4-brom-anthrachinon; 1-amino-4-bromo-9,10-anthracenedione; 4-bromo-1-aminoanthraquinone; 1-amino-4-bromo-anthraquinone; 1-amino-4-bromo-9,10-anthraquinone; MFCD00156864; 9,10-Anthracenedione,1-amino-4-bromo |
| Molecular Formula | C21H12BrNO3 |
| Molecular Weight | 406.239 |
| Purity | 98.00 |
| Density | 1.701 g/cm3 |
| Boiling Point | 512.2ºC at 760 mmHg |
| Melting Point | 14ºC |
| HTC | 2922399090 |
| MDL Number | MFCD00194214 |
| SMILES | Nc1ccc(Br)c2c1C(=O)c1ccccc1C2=O |
| InChI Key | JOVRIPGYHSRFFR-UHFFFAOYSA-N |
| MSDS | msds/17351_1_81_62_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Dihydrotachysterol | 67-96-9 | 2A-9016963 |
| 1,2-Dihydroxy anthraquinone | 72-48-0 | 2A-9017031 |
| Dihydrocholesterol | 80-97-7 | 2A-9017326 |
| 1,8-Dihydroxy-4,5-dinitroanthraquinone | 81-55-0 | 2A-9017349 |
| 1,4,5,8-Tetrachloroanthraquinone | 81-58-3 | 2A-9017350 |
| 1-Chloro anthraquinone | 82-44-0 | 2A-9017369 |
| 1-Amino anthraquinone | 82-45-1 | 2A-9017370 |
| 1-Anthraquinonesulfonic acid | 82-49-5 | 2A-9017371 |
| beta-Sitosterol | 83-46-5 | 2A-9017394 |
| 2-tert-Butylanthraquinone | 84-47-9 | 2A-9017411 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA