
CAS Number82-45-1
Synonyms1-Aminoanthrachinon; 9,10-Anthracenedione,1-amino; Diazo Fast Red AL; 1-Amino-9,10-anthraquinone; 1-AMINOANTHRAQUINONE; Anthraquinone,1-amino
Molecular FormulaC14H9NO2
Molecular Weight223.23
Purity≥96.5 (HPLC)%
Density1.383g/cm3
Boiling Point464.9ºC at 760mmHg
Melting Point253-255 °C (lit.)
Appearancepowder, crystals or chunks
EINECS201-423-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82-45-1 |
| Catalog No. | 2A-9017370 |
| Chinese Name | 氨基-9,10-蒽二酮 |
| Synonyms | 1-Aminoanthrachinon; 9,10-Anthracenedione,1-amino; Diazo Fast Red AL; 1-Amino-9,10-anthraquinone; 1-AMINOANTHRAQUINONE; Anthraquinone,1-amino |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 |
| Purity | ≥96.5 (HPLC) |
| Density | 1.383g/cm3 |
| Boiling Point | 464.9ºC at 760mmHg |
| Melting Point | 253-255 °C (lit.) |
| Appearance | powder, crystals or chunks |
| EINECS | 201-423-5 |
| HTC | 2922399090 |
| PubChem ID | 24890825 |
| MDL Number | MFCD00001213 |
| SMILES | Nc1cccc2C(=O)c3ccccc3C(=O)c12 |
| InChI | 1S/C14H9NO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H,15H2 |
| InChI Key | KHUFHLFHOQVFGB-UHFFFAOYSA-N |
| Beilstein/REAXYS | 396360 |
| NACRES Code | NA.47 |
| UNSPSC | 12171500 |
| MSDS | msds/17370_1_82_45_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Dihydrocholesterol | 80-97-7 | 2A-9017326 |
| 1,8-Dihydroxy-4,5-dinitroanthraquinone | 81-55-0 | 2A-9017349 |
| 1,4,5,8-Tetrachloroanthraquinone | 81-58-3 | 2A-9017350 |
| 1-Amino-4-bromo anthraquinone | 81-62-9 | 2A-9017351 |
| 1-Chloro anthraquinone | 82-44-0 | 2A-9017369 |
| 1-Anthraquinonesulfonic acid | 82-49-5 | 2A-9017371 |
| beta-Sitosterol | 83-46-5 | 2A-9017394 |
| 2-tert-Butylanthraquinone | 84-47-9 | 2A-9017411 |
| 2-Anthraquinonesulfonic acid | 84-48-0 | 2A-9017412 |
| 2-Ethyl anthraquinone | 84-51-5 | 2A-9017413 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA