
CAS Number84-51-5
SynonymsEINECS 201-535-4; 2-Ethyl-9,10-anthraquinone; 2-Ethyl-9,10-anthracenedione; 2-ethylanthracene-9,10-dione; MFCD00001237; 2-Ethylanthra-9,10-quinone; L C666 BV IVJ E2; 2-Ethylanthraquinone
Molecular FormulaC16H12O2
Molecular Weight236.27
Purity≥97%
Density1.2±0.1 g/cm3
Boiling Point415.4±35.0 °C at 760 mmHg
Melting Point108-111 °C (lit.)
Appearancepornographic films
EINECS201-535-4
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84-51-5 |
| Catalog No. | 2A-9017413 |
| Chinese Name | 2-乙基蒽醌 |
| Synonyms | EINECS 201-535-4; 2-Ethyl-9,10-anthraquinone; 2-Ethyl-9,10-anthracenedione; 2-ethylanthracene-9,10-dione; MFCD00001237; 2-Ethylanthra-9,10-quinone; L C666 BV IVJ E2; 2-Ethylanthraquinone |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 |
| Purity | ≥97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 415.4±35.0 °C at 760 mmHg |
| Melting Point | 108-111 °C (lit.) |
| Appearance | pornographic films |
| Storage Condition | This product should be sealed and stored in a cool |
| Packaging | II; III |
| EINECS | 201-535-4 |
| HTC | 2914610000 |
| PubChem ID | 24894394 |
| MDL Number | MFCD00001237 |
| SMILES | CCc1ccc2C(=O)c3ccccc3C(=O)c2c1 |
| InChI | 1S/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 |
| InChI Key | SJEBAWHUJDUKQK-UHFFFAOYSA-N |
| NACRES Code | NA.23 |
| UNSPSC | 12352103 |
| Hazard Symbols | 4.1 |
| MSDS | msds/17413_1_84_51_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| 1-Amino anthraquinone | 82-45-1 | 2A-9017370 |
| 1-Anthraquinonesulfonic acid | 82-49-5 | 2A-9017371 |
| beta-Sitosterol | 83-46-5 | 2A-9017394 |
| 2-tert-Butylanthraquinone | 84-47-9 | 2A-9017411 |
| 2-Anthraquinonesulfonic acid | 84-48-0 | 2A-9017412 |
| 2-Methyl anthraquinone | 84-54-8 | 2A-9017414 |
| 4-Methylumbelliferone | 90-33-5 | 2A-9017663 |
| Scopoletin | 92-61-5 | 2A-9017759 |
| alpha-D-Methylglucoside | 97-30-3 | 2A-9018007 |
| 4,4'-Stilbenedicarboxylic acid | 100-31-2 | 2A-9018190 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA