CAS Number56674-88-5
Synonyms5-carbomethoxy-adamantan-2-one; methyl 2-adamantanone-5-carboxylate; 5-carbomethoxyadamant-2-one; 4-oxo-adamantane-1-carboxylic acid methyl ester; Tricyclo[3.3.1.1]decane-1-carboxylic acid, 4-oxo-, methyl ester; 2-adamantanone-5-carboxylic acid methyl ester; Methyl 4-oxo-1-adamantanecarboxylate; Methyl4-oxoadamantane-1-carboxylate; HMS1399H22
Molecular FormulaC12H16O3
Molecular Weight208.254
Density1.2±0.1 g/cm3
Boiling Point300.9±35.0 °C at 760 mmHg
Melting Point53-54 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56674-88-5 |
| Catalog No. | 2A-1170285 |
| Chinese Name | 5-甲酸甲酯-2-金刚烷酮 |
| Synonyms | 5-carbomethoxy-adamantan-2-one; methyl 2-adamantanone-5-carboxylate; 5-carbomethoxyadamant-2-one; 4-oxo-adamantane-1-carboxylic acid methyl ester; Tricyclo[3.3.1.1]decane-1-carboxylic acid, 4-oxo-, methyl ester; 2-adamantanone-5-carboxylic acid methyl ester; Methyl 4-oxo-1-adamantanecarboxylate; Methyl4-oxoadamantane-1-carboxylate; HMS1399H22 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.254 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 300.9±35.0 °C at 760 mmHg |
| Melting Point | 53-54 °C |
| Storage Condition | Room temperature, inert atmosphere |
| HTC | 2918300090 |
| SMILES | COC(=O)C12CC3CC(C1)C(=O)C(C3)C2 |
| InChI Key | DUPFRYAOGHZOCO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Pyridinecarboxylicacid, 2-phenylhydrazide | 91396-88-2 | 2A-1170167 |
| (2-Iodo-5-methoxyphenyl)boronic acid | 89694-50-8 | 2A-1170209 |
| 1-BROMO-4-NAPHTHALDEHYDE | 50672-84-9 | 2A-1170212 |
| 2-amino-4-methoxy-benzaldehyde | 59236-36-1 | 2A-1170231 |
| (R)-1-(2-(2,5-dichlorobenzamido)acetamido)-3-methylbutylboronic acid | 1072833-77-2 | 2A-1170245 |
| [(2R)-1-[(2S)-2-Amino-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid mesylate | 150080-09-4 | 2A-1170388 |
| 4-OXO-1,4-DIHYDRO-[1,10]PHENANTHROLINE-3-CARBOXYLIC ACID | 331830-20-7 | 2A-1170458 |
| 2-(3,5-bis(trifluoroMethyl)phenyl)-2-Methyl propanoic acid | 289686-70-0 | 2A-1170481 |
| 1-Bromo-6-trifluoromethyl-naphthalene | 117539-60-3 | 2A-1170495 |
| Ethyl - [[3-amino-4-(methylamino) benzoyl]-[pyridin-2-yl-beta-amino] propanoate | 212332-56-0 | 2A-1170507 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS