
CAS Number1072833-77-2
SynonymsB-{(1R)-1-[2-(2,5-dichlorobenzamido)acetamido]-3-methylbutyl}boronic acid; N-(2,5-Dichlorobenzoyl)-N-[(1R)-1-(dihydroxyboryl)-3-methylbutyl]glycinamide; [(1R)-1-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-3-methyl-butyl]boronic acid; MLN2238; ixazomib; Ixazomib; B-[(1R)-1-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid
Molecular FormulaC14H19BCl2N2O4
Molecular Weight361.029
Density1.3±0.1 g/cm3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1072833-77-2 |
| Catalog No. | 2A-1170245 |
| Chinese Name | 艾沙佐米 |
| Synonyms | B-{(1R)-1-[2-(2,5-dichlorobenzamido)acetamido]-3-methylbutyl}boronic acid; N-(2,5-Dichlorobenzoyl)-N-[(1R)-1-(dihydroxyboryl)-3-methylbutyl]glycinamide; [(1R)-1-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-3-methyl-butyl]boronic acid; MLN2238; ixazomib; Ixazomib; B-[(1R)-1-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid |
| Molecular Formula | C14H19BCl2N2O4 |
| Molecular Weight | 361.029 |
| Density | 1.3±0.1 g/cm3 |
| Storage Condition | 2-8°C |
| Application | Ixazomib (MLN2238) is a potent and selective reversible proteasome inhibitor that inhibits the chymotrypsin-like proteolytic (β5) site of the 20S proteasome with an IC50 of 3.4 nM and a Ki of 0.93 nM. |
| PubChem ID | 57291607 |
| SMILES | CC(C)CC(NC(=O)CNC(=O)c1cc(Cl)ccc1Cl)B(O)O |
| InChI | InChI=1S/C14H19BCl2N2O4/c1-8(2)5-12(15(22)23)19-13(20)7-18-14(21)10-6-9(16)3-4-11(10)17/h3-4,6,8,12,22-23H,5,7H2,1-2H3,(H,18,21)(H,19,20)/t12-/m0/s1 |
| InChI Key | MXAYKZJJDUDWDS-LBPRGKRZSA-N |
| Transport Info | Product name: MLN2238 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 9-(DichloroMethylene)-1,2,3,4-tetrahydro-1,4-Methanonaphthalen-5-aMine | 935772-63-7 | 2A-1170159 |
| 4-Pyridinecarboxylicacid, 2-phenylhydrazide | 91396-88-2 | 2A-1170167 |
| (2-Iodo-5-methoxyphenyl)boronic acid | 89694-50-8 | 2A-1170209 |
| 1-BROMO-4-NAPHTHALDEHYDE | 50672-84-9 | 2A-1170212 |
| 2-amino-4-methoxy-benzaldehyde | 59236-36-1 | 2A-1170231 |
| 4-Oxoadamantane-1-carboxylic acid methyl ester | 56674-88-5 | 2A-1170285 |
| [(2R)-1-[(2S)-2-Amino-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid mesylate | 150080-09-4 | 2A-1170388 |
| 4-OXO-1,4-DIHYDRO-[1,10]PHENANTHROLINE-3-CARBOXYLIC ACID | 331830-20-7 | 2A-1170458 |
| 2-(3,5-bis(trifluoroMethyl)phenyl)-2-Methyl propanoic acid | 289686-70-0 | 2A-1170481 |
| 1-Bromo-6-trifluoromethyl-naphthalene | 117539-60-3 | 2A-1170495 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA