
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 50672-84-9 |
| Catalog No. | 2A-1170212 |
| Chinese Name | 4-溴-1-萘甲醛 |
| Synonyms | 4-bromonaphthalene-1-carbaldehyde |
| Molecular Formula | C11H7BrO |
| Molecular Weight | 235.07700 |
| Purity | 98% |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2913000090 |
| PubChem ID | 6836681 |
| SMILES | O=Cc1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C11H7BrO/c12-11-6-5-8(7-13)9-3-1-2-4-10(9)11/h1-7H |
| InChI Key | SESASPRCAIMYLA-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 1 3-DI-Z-2-(TRIFLUOROMETHYLSULFONYL)- | 207857-19-0 | 2A-1170135 |
| (1,10-Phenanthroline)(trifluoroMethyl)copper(I) | 1300746-79-5 | 2A-1170155 |
| 9-(DichloroMethylene)-1,2,3,4-tetrahydro-1,4-Methanonaphthalen-5-aMine | 935772-63-7 | 2A-1170159 |
| 4-Pyridinecarboxylicacid, 2-phenylhydrazide | 91396-88-2 | 2A-1170167 |
| (2-Iodo-5-methoxyphenyl)boronic acid | 89694-50-8 | 2A-1170209 |
| 2-amino-4-methoxy-benzaldehyde | 59236-36-1 | 2A-1170231 |
| (R)-1-(2-(2,5-dichlorobenzamido)acetamido)-3-methylbutylboronic acid | 1072833-77-2 | 2A-1170245 |
| 4-Oxoadamantane-1-carboxylic acid methyl ester | 56674-88-5 | 2A-1170285 |
| [(2R)-1-[(2S)-2-Amino-3-methylbutanoyl]pyrrolidin-2-yl]boronic acid mesylate | 150080-09-4 | 2A-1170388 |
| 4-OXO-1,4-DIHYDRO-[1,10]PHENANTHROLINE-3-CARBOXYLIC ACID | 331830-20-7 | 2A-1170458 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA