
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 587-48-4 |
| Catalog No. | 2A-9086068 |
| Chinese Name | 3-乙酰胺基苯甲酸 |
| Synonyms | EINECS 209-600-9; 3-Acetamidobenzoic acid; MFCD00013983 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.173 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 444.1±28.0 °C at 760 mmHg |
| Melting Point | 247-252 °C |
| Appearance | beige powder |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2924299090 |
| SMILES | CC(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C9H9NO3.Na/c1-6(11)10-8-4-2-3-7(5-8)9(12)13;/h2-5H,1H3,(H,10,11)(H,12,13);/q;+1/p-1 |
| InChI Key | RGDPZMQZWZMONQ-UHFFFAOYSA-N |
| MSDS | msds/86068_1_587_48_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 99.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3-Acetamidobenzoic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl3,5-dibenzyloxybenzoate | 58605-10-0 | 2A-9086062 |
| 2-Acetoxy-5-nitrobenzylchloride | 5174-32-3 | 2A-9086064 |
| 3-(P-Chlorobenzoyl)-2-methylpropionicacid | 52240-20-7 | 2A-9086065 |
| 2-Methyl-4-oxo-4-(4'-methoxyphenyl)butyricacid | 5717-16-8 | 2A-9086066 |
| Methyl2-(2-Bromophenyl)Acetate | 57486-69-8 | 2A-9086067 |
| Methyl2-nitrobenzoate | 606-27-9 | 2A-9086069 |
| TribromophenylAcetate | 607-95-4 | 2A-9086070 |
| 3-Oxo-4-P-Tolyl-butyricacidethylester | 62135-86-8 | 2A-9086071 |
| Acetyl-2-methylcholinechloride | 62-51-1 | 2A-9086072 |
| Abieticacidethylester | 631-71-0 | 2A-9086074 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA