
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58605-10-0 |
| Catalog No. | 2A-9086062 |
| Chinese Name | 3,5-二苄氧基苯甲酸甲酯 |
| Synonyms | methyl 3,5-dibenzyloxybenzoate; MFCD00157205 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.4 |
| Density | 1.174g/cm3 |
| Boiling Point | 506.2ºC at 760 mmHg |
| Melting Point | 67 °C |
| Appearance | Solid;White to Orange to Green powder to crystal |
| Storage Condition | Store in an airtight container in a dry, cool plac |
| Packaging | III |
| HTC | 2918990090 |
| MDL Number | MFCD02728721 |
| SMILES | COC(=O)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H20O4/c1-24-22(23)19-12-20(25-15-17-8-4-2-5-9-17)14-21(13-19)26-16-18-10-6-3-7-11-18/h2-14H,15-16H2,1H3 |
| InChI Key | GBQCMRLPXFXVIN-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/86062_1_58605_10_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzylethylmalonate | 42998-51-6 | 2A-9086056 |
| Diethylacetoxymalonate | 5468-23-5 | 2A-9086058 |
| p-Cresolisovalerate | 55066-56-3 | 2A-9086059 |
| 8-(Aminocarbonyl)-1-naphthoicacid | 5811-88-1 | 2A-9086060 |
| DiethylIsopropylmethylmalonate | 58447-69-1 | 2A-9086061 |
| 2-Acetoxy-5-nitrobenzylchloride | 5174-32-3 | 2A-9086064 |
| 3-(P-Chlorobenzoyl)-2-methylpropionicacid | 52240-20-7 | 2A-9086065 |
| 2-Methyl-4-oxo-4-(4'-methoxyphenyl)butyricacid | 5717-16-8 | 2A-9086066 |
| Methyl2-(2-Bromophenyl)Acetate | 57486-69-8 | 2A-9086067 |
| 3-(Acetylamino)benzoicacid | 587-48-4 | 2A-9086068 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA