Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 52240-20-7 |
| Catalog No. | 2A-9086065 |
| Chinese Name | 3-(对氯苯甲酰)-2-甲基丙酸 |
| Synonyms | MFCD01863260 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 357.79 |
| Purity | ≥98 (by assay) |
| Boiling Point | 407.6ºC at 760mmHg |
| Melting Point | 137-139ºC |
| Appearance | powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2918300090 |
| MDL Number | MFCD00057095 |
| SMILES | Clc1ccc(cc1)C(=O)[n]2c3c(c(c2C)CC(=O)O)cc(cc3)OC |
| InChI | 1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
| InChI Key | CGIGDMFJXJATDK-UHFFFAOYSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/86065_1_52240_20_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| p-Cresolisovalerate | 55066-56-3 | 2A-9086059 |
| 8-(Aminocarbonyl)-1-naphthoicacid | 5811-88-1 | 2A-9086060 |
| DiethylIsopropylmethylmalonate | 58447-69-1 | 2A-9086061 |
| Methyl3,5-dibenzyloxybenzoate | 58605-10-0 | 2A-9086062 |
| 2-Acetoxy-5-nitrobenzylchloride | 5174-32-3 | 2A-9086064 |
| 2-Methyl-4-oxo-4-(4'-methoxyphenyl)butyricacid | 5717-16-8 | 2A-9086066 |
| Methyl2-(2-Bromophenyl)Acetate | 57486-69-8 | 2A-9086067 |
| 3-(Acetylamino)benzoicacid | 587-48-4 | 2A-9086068 |
| Methyl2-nitrobenzoate | 606-27-9 | 2A-9086069 |
| TribromophenylAcetate | 607-95-4 | 2A-9086070 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS