
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5174-32-3 |
| Catalog No. | 2A-9086064 |
| Chinese Name | 2-乙酰基-5-硝基苄氯 |
| Synonyms | bia1040; 2-acetoxy-5-nitrobenzyl chloride |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 194.18 |
| Density | 1.378g/cm3 |
| Boiling Point | 382.2ºC at 760 mmHg |
| Appearance | solid |
| HTC | 2915390090 |
| PubChem ID | 329815482 |
| MDL Number | MFCD02114695 |
| SMILES | CC(=O)Oc1ccc(O)c(c1)C(C)=O |
| InChI | 1S/C10H10O4/c1-6(11)9-5-8(14-7(2)12)3-4-10(9)13/h3-5,13H,1-2H3 |
| InChI Key | MMOTWJGMUVIYAQ-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/86064_1_5174_32_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diethylacetoxymalonate | 5468-23-5 | 2A-9086058 |
| p-Cresolisovalerate | 55066-56-3 | 2A-9086059 |
| 8-(Aminocarbonyl)-1-naphthoicacid | 5811-88-1 | 2A-9086060 |
| DiethylIsopropylmethylmalonate | 58447-69-1 | 2A-9086061 |
| Methyl3,5-dibenzyloxybenzoate | 58605-10-0 | 2A-9086062 |
| 3-(P-Chlorobenzoyl)-2-methylpropionicacid | 52240-20-7 | 2A-9086065 |
| 2-Methyl-4-oxo-4-(4'-methoxyphenyl)butyricacid | 5717-16-8 | 2A-9086066 |
| Methyl2-(2-Bromophenyl)Acetate | 57486-69-8 | 2A-9086067 |
| 3-(Acetylamino)benzoicacid | 587-48-4 | 2A-9086068 |
| Methyl2-nitrobenzoate | 606-27-9 | 2A-9086069 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA