
CAS Number5717-16-8
SynonymsD-5015; 4-(4-methoxyphenyl)-2-methyl-4-oxidanylidene-butanoic acid; 4-(4-Methoxy-phenyl)-2-methyl-4-oxo-buttersaeure; 2-methyl-4-oxo-4-(4-methoxyphenyl)-butyric acid; 4-(4-methoxyphenyl)-2-methyl-4-oxobutyric acid
Molecular FormulaC12H14O4
Molecular Weight247.25
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5717-16-8 |
| Catalog No. | 2A-9086066 |
| Chinese Name | 4-(4-甲氧基苯基)-2-甲基-4-氧代丁酸 |
| Synonyms | D-5015; 4-(4-methoxyphenyl)-2-methyl-4-oxidanylidene-butanoic acid; 4-(4-Methoxy-phenyl)-2-methyl-4-oxo-buttersaeure; 2-methyl-4-oxo-4-(4-methoxyphenyl)-butyric acid; 4-(4-methoxyphenyl)-2-methyl-4-oxobutyric acid |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 247.25 |
| Appearance | solid |
| HTC | 2918990090 |
| PubChem ID | 329819347 |
| MDL Number | MFCD21090567 |
| SMILES | N(c1ccc(cc1)C(=O)C)C(=O)\C=C(/C)\C(=O)O |
| InChI | 1S/C13H13NO4/c1-8(13(17)18)7-12(16)14-11-5-3-10(4-6-11)9(2)15/h3-7H,1-2H3,(H,14,16)(H,17,18)/b8-7+ |
| InChI Key | VNRMCTMANZPEIC-BQYQJAHWSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/86066_1_5717_16_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 8-(Aminocarbonyl)-1-naphthoicacid | 5811-88-1 | 2A-9086060 |
| DiethylIsopropylmethylmalonate | 58447-69-1 | 2A-9086061 |
| Methyl3,5-dibenzyloxybenzoate | 58605-10-0 | 2A-9086062 |
| 2-Acetoxy-5-nitrobenzylchloride | 5174-32-3 | 2A-9086064 |
| 3-(P-Chlorobenzoyl)-2-methylpropionicacid | 52240-20-7 | 2A-9086065 |
| Methyl2-(2-Bromophenyl)Acetate | 57486-69-8 | 2A-9086067 |
| 3-(Acetylamino)benzoicacid | 587-48-4 | 2A-9086068 |
| Methyl2-nitrobenzoate | 606-27-9 | 2A-9086069 |
| TribromophenylAcetate | 607-95-4 | 2A-9086070 |
| 3-Oxo-4-P-Tolyl-butyricacidethylester | 62135-86-8 | 2A-9086071 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA