
CAS Number3987-86-8
SynonymsBenzenamine,4-butoxy-2-nitro; 2-Nitro-4-butyloxy-anilin; 4-butoxy-2-nitrophenylamine; 4-butoxy-2-nitro-aniline; 2-Amino-5-butoxynitrobenzene; MFCD01320679; 1-amino-4-n-butoxy-2-nitrobenzene; 4-n-butoxy-2-nitroaniline; 4-Butoxy-2-nitro-anilin
Molecular FormulaCH3OC6H3(NO2)NH2
Molecular Weight168.15
Purity98%
Density1.187g/cm3
Boiling Point366.9ºC at 760mmHg
Melting Point140-142 °C (lit.)
AppearanceRed fine crystalline powder
EINECS202-588-6
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3987-86-8 |
| Catalog No. | 2A-9084822 |
| Chinese Name | 4-丁氧基-2-硝基苯胺 |
| Synonyms | Benzenamine,4-butoxy-2-nitro; 2-Nitro-4-butyloxy-anilin; 4-butoxy-2-nitrophenylamine; 4-butoxy-2-nitro-aniline; 2-Amino-5-butoxynitrobenzene; MFCD01320679; 1-amino-4-n-butoxy-2-nitrobenzene; 4-n-butoxy-2-nitroaniline; 4-Butoxy-2-nitro-anilin |
| Molecular Formula | CH3OC6H3(NO2)NH2 |
| Molecular Weight | 168.15 |
| Purity | 98 |
| Density | 1.187g/cm3 |
| Boiling Point | 366.9ºC at 760mmHg |
| Melting Point | 140-142 °C (lit.) |
| Appearance | Red fine crystalline powder |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| EINECS | 202-588-6 |
| HTC | 2922299090 |
| PubChem ID | 24847104 |
| MDL Number | MFCD00007363 |
| SMILES | COc1cc(ccc1N)[N+]([O-])=O |
| InChI | 1S/C7H8N2O3/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,8H2,1H3 |
| InChI Key | GVBHRNIWBGTNQA-UHFFFAOYSA-N |
| Beilstein/REAXYS | 879619 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/84822_1_3987_86_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(Benzyloxy)-4-nitroaniline | 25945-96-4 | 2A-9084814 |
| 3,4-Dinitroaniline | 610-41-3 | 2A-9084815 |
| N-Ethyl-4-fluoro-2-nitroaniline | 774-22-1 | 2A-9084817 |
| 3-Methoxy-5-nitro-phenylamine | 586-10-7 | 2A-9084819 |
| 2-Chloro-6-methyl-4-nitroaniline | 69951-02-6 | 2A-9084820 |
| 4-Chloro-2-methyl-6-nitroaniline | 62790-50-5 | 2A-9084823 |
| 2,6-Diisopropyl-4-nitroaniline | 163704-72-1 | 2A-9084825 |
| 4-Bromo-2-nitrophenylhydrazine | 59488-34-5 | 2A-9084831 |
| Pentafluorophenylhydrazine | 828-73-9 | 2A-9084832 |
| 4-Nitrophenylphosphatedi(tris)salt | 68189-42-4 | 2A-9084837 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA