
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 69951-02-6 |
| Catalog No. | 2A-9084820 |
| Chinese Name | 2-氯-6-甲基-4-硝基苯胺 |
| Synonyms | MFCD01313703; 2-Chloro-6-methyl-4-nitroaniline |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.6 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 344.6±37.0 °C at 760 mmHg |
| Melting Point | 170-175 °C |
| Appearance | Yellow to dark yellow crystalline powder or needle |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2921430090 |
| MDL Number | MFCD01313703 |
| SMILES | Cc1cc([N+](=O)[O-])cc(Cl)c1N |
| InChI | InChI=1S/C7H7ClN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3 |
| InChI Key | HVPVUAIKGOKEEE-UHFFFAOYSA-N |
| MSDS | msds/84820_1_69951_02_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6,8-Dimethyl-3-formylchromone | 42059-75-6 | 2A-9084813 |
| 2-(Benzyloxy)-4-nitroaniline | 25945-96-4 | 2A-9084814 |
| 3,4-Dinitroaniline | 610-41-3 | 2A-9084815 |
| N-Ethyl-4-fluoro-2-nitroaniline | 774-22-1 | 2A-9084817 |
| 3-Methoxy-5-nitro-phenylamine | 586-10-7 | 2A-9084819 |
| 4-Butoxy-2-nitroaniline | 3987-86-8 | 2A-9084822 |
| 4-Chloro-2-methyl-6-nitroaniline | 62790-50-5 | 2A-9084823 |
| 2,6-Diisopropyl-4-nitroaniline | 163704-72-1 | 2A-9084825 |
| 4-Bromo-2-nitrophenylhydrazine | 59488-34-5 | 2A-9084831 |
| Pentafluorophenylhydrazine | 828-73-9 | 2A-9084832 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA