
CAS Number610-41-3
Synonyms3,4-dinitrophenylamine; 3,4-dinitro-aniline; 3,4-Dinitroanilin; 3,4-dinitrobenzenamine; MFCD00456811; Benzenamine,3,4-dinitro
Molecular FormulaC8H9N3O4
Molecular Weight211.179
Density1.376 g/mL at 25 °C(lit.)
Boiling Point71 °C(lit.)
Melting Point154-158 °C(lit.)
AppearanceLight yellow to brown solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 610-41-3 |
| Catalog No. | 2A-9084815 |
| Chinese Name | 3,4-二硝基苯 |
| Synonyms | 3,4-dinitrophenylamine; 3,4-dinitro-aniline; 3,4-Dinitroanilin; 3,4-dinitrobenzenamine; MFCD00456811; Benzenamine,3,4-dinitro |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.179 |
| Density | 1.376 g/mL at 25 °C(lit.) |
| Boiling Point | 71 °C(lit.) |
| Melting Point | 154-158 °C(lit.) |
| Appearance | Light yellow to brown solid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| Packaging | II |
| HTC | 2921420090 |
| MDL Number | MFCD00024207 |
| SMILES | Nc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H5N3O4/c7-4-1-2-5(8(10)11)6(3-4)9(12)13/h1-3H,7H2 |
| InChI Key | IPZPZSUDOPUDPM-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| MSDS | msds/84815_1_610_41_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,5-Dichlorobenzylchloride | 2745-49-5 | 2A-9084792 |
| 4,4',4"-Trimethoxytritylchloride | 49757-42-8 | 2A-9084803 |
| 4-Bromo-4'-heptylbiphenyl | 58573-93-6 | 2A-9084811 |
| 6,8-Dimethyl-3-formylchromone | 42059-75-6 | 2A-9084813 |
| 2-(Benzyloxy)-4-nitroaniline | 25945-96-4 | 2A-9084814 |
| N-Ethyl-4-fluoro-2-nitroaniline | 774-22-1 | 2A-9084817 |
| 3-Methoxy-5-nitro-phenylamine | 586-10-7 | 2A-9084819 |
| 2-Chloro-6-methyl-4-nitroaniline | 69951-02-6 | 2A-9084820 |
| 4-Butoxy-2-nitroaniline | 3987-86-8 | 2A-9084822 |
| 4-Chloro-2-methyl-6-nitroaniline | 62790-50-5 | 2A-9084823 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA