
CAS Number25945-96-4
Synonymsghl.PD_Mitscher_leg0.610; 2-(3-CHLOROPHENYL)-3-(DIMETHYLAMINO)ACRYLALDEHYDE; 2-benzyloxy-4-nitro-phenylamine; 4-nitro-2-phenylmethoxy-aniline; 2-benzyloxy-4-nitro-aniline; 2-Benzyloxy-4-nitroanilin
Molecular FormulaC13H12N2O3
Molecular Weight244.252
Density1.297g/cm3
Boiling Point463.3ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 25945-96-4 |
| Catalog No. | 2A-9084814 |
| Chinese Name | 2-(苄氧基)-4-硝基苯胺 |
| Synonyms | ghl.PD_Mitscher_leg0.610; 2-(3-CHLOROPHENYL)-3-(DIMETHYLAMINO)ACRYLALDEHYDE; 2-benzyloxy-4-nitro-phenylamine; 4-nitro-2-phenylmethoxy-aniline; 2-benzyloxy-4-nitro-aniline; 2-Benzyloxy-4-nitroanilin |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.252 |
| Density | 1.297g/cm3 |
| Boiling Point | 463.3ºC at 760 mmHg |
| Storage Condition | -20°C |
| HTC | 2922199090 |
| MDL Number | MFCD00024263 |
| SMILES | Nc1ccc([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI Key | OTBQGZCBYVALOL-UHFFFAOYSA-N |
| MSDS | msds/84814_1_25945_96_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-[(Dimethylamino)methylene]-3-oxo-3-(2-thienyl)propanenitrile | 52200-22-3 | 2A-9084781 |
| 2,5-Dichlorobenzylchloride | 2745-49-5 | 2A-9084792 |
| 4,4',4"-Trimethoxytritylchloride | 49757-42-8 | 2A-9084803 |
| 4-Bromo-4'-heptylbiphenyl | 58573-93-6 | 2A-9084811 |
| 6,8-Dimethyl-3-formylchromone | 42059-75-6 | 2A-9084813 |
| 3,4-Dinitroaniline | 610-41-3 | 2A-9084815 |
| N-Ethyl-4-fluoro-2-nitroaniline | 774-22-1 | 2A-9084817 |
| 3-Methoxy-5-nitro-phenylamine | 586-10-7 | 2A-9084819 |
| 2-Chloro-6-methyl-4-nitroaniline | 69951-02-6 | 2A-9084820 |
| 4-Butoxy-2-nitroaniline | 3987-86-8 | 2A-9084822 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA