
CAS Number586-10-7
Synonyms5-Nitro-3-amino-phenol-methylaether; 3-methoxy-5-nitro-aniline; 3-Methoxy-5-nitro-anilin; 5-Nitro-m-anisidin; 3-methoxy-5-nitro-phenylamine; MFCD01103799
Molecular FormulaC7H8N2O3
Molecular Weight231.59
Density1.318g/cm3
Boiling Point365.3ºC at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 586-10-7 |
| Catalog No. | 2A-9084819 |
| Chinese Name | 3-甲氧基-5-硝基苯胺 |
| Synonyms | 5-Nitro-3-amino-phenol-methylaether; 3-methoxy-5-nitro-aniline; 3-Methoxy-5-nitro-anilin; 5-Nitro-m-anisidin; 3-methoxy-5-nitro-phenylamine; MFCD01103799 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 231.59 |
| Density | 1.318g/cm3 |
| Boiling Point | 365.3ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | room temperature |
| HTC | 2921420090 |
| PubChem ID | 329816596 |
| MDL Number | MFCD17167535 |
| SMILES | CC1=CC([N+]([O-])=O)=C(OC)C(C(O)=O)=C1 |
| InChI | 1S/C9H9NO5/c1-5-3-6(9(11)12)8(15-2)7(4-5)10(13)14/h3-4H,1-2H3,(H,11,12) |
| InChI Key | KJPNRXSFTKTXSH-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/84819_1_586_10_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Bromo-4'-heptylbiphenyl | 58573-93-6 | 2A-9084811 |
| 6,8-Dimethyl-3-formylchromone | 42059-75-6 | 2A-9084813 |
| 2-(Benzyloxy)-4-nitroaniline | 25945-96-4 | 2A-9084814 |
| 3,4-Dinitroaniline | 610-41-3 | 2A-9084815 |
| N-Ethyl-4-fluoro-2-nitroaniline | 774-22-1 | 2A-9084817 |
| 2-Chloro-6-methyl-4-nitroaniline | 69951-02-6 | 2A-9084820 |
| 4-Butoxy-2-nitroaniline | 3987-86-8 | 2A-9084822 |
| 4-Chloro-2-methyl-6-nitroaniline | 62790-50-5 | 2A-9084823 |
| 2,6-Diisopropyl-4-nitroaniline | 163704-72-1 | 2A-9084825 |
| 4-Bromo-2-nitrophenylhydrazine | 59488-34-5 | 2A-9084831 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA