
CAS Number14685-90-6
Synonyms4-Hydrazino-benzoic acid ethyl ester; Ethyl 4-hydrazinobenzoate; (4-hydrazino)ethylbenzoate; 4-Ethoxycarbonylphenylhydrazine; Benzoic acid, 4-hydrazinyl-, ethyl ester; 4-Hydrazinyl-Benzoic Acid Ethyl Ester
Molecular FormulaC9H12O2N2
Molecular Weight180.21
Density1.2±0.1 g/cm3
Boiling Point329.9±25.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14685-90-6 |
| Catalog No. | 2A-9076704 |
| Chinese Name | 4-肼基苯甲酸乙酯 |
| Synonyms | 4-Hydrazino-benzoic acid ethyl ester; Ethyl 4-hydrazinobenzoate; (4-hydrazino)ethylbenzoate; 4-Ethoxycarbonylphenylhydrazine; Benzoic acid, 4-hydrazinyl-, ethyl ester; 4-Hydrazinyl-Benzoic Acid Ethyl Ester |
| Molecular Formula | C9H12O2N2 |
| Molecular Weight | 180.21 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 329.9±25.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, protected from light, stored in inert gas |
| HTC | 2928000090 |
| PubChem ID | 3290266 |
| MDL Number | MFCD00278571 |
| SMILES | CCOC(=O)c1ccc(NN)cc1 |
| InChI | InChI=1S/C9H12N2O2/c1-2-13-9(12)7-3-5-8(11-10)6-4-7/h3-6,11H,2,10H2,1H3 |
| InChI Key | JYYDHGMTXHCSKZ-UHFFFAOYSA-N |
| MSDS | msds/76704_1_14685_90_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-5-chloro-1,3-dimethylbenzene | 14659-58-6 | 2A-9076693 |
| 4-Bromophenyltrifluoromethanesulfonate | 129112-25-0 | 2A-9076694 |
| 3-Chloro-4-(trifluoromethoxy)benzonitrile | 129604-26-8 | 2A-9076697 |
| Methyl(5-hydroxymethyl)nicotinate | 129747-52-0 | 2A-9076698 |
| 4-Ethylbenzylchloride | 1467-05-6 | 2A-9076699 |
| 4-Amino-2-methyl-5-nitro-benzoicacidmethylester | 146948-44-9 | 2A-9076706 |
| But-3-Enoylchloride | 1470-91-3 | 2A-0201929 |
| 1-Benzothiophen-3(2H)-one | 130-03-0 | 2A-9076716 |
| 3-Chloropropylmethylsulfane | 13012-59-4 | 2A-9076721 |
| 6-Allyloxycarbonylamino-2-amino-hexanoicacid | 147529-99-5 | 2A-9076723 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA