
CAS Number1467-05-6
Synonyms1-(Chloromethyl)-4-ethylbenzene; 1-(Chlormethyl)-4-ethylbenzol; MFCD00039357; 4-Ethylbenzyl chloride; p-ethylbenzylchloride
Molecular FormulaC9H11Cl1
Molecular Weight154.64
Density1.0±0.1 g/cm3
Boiling Point217.1±9.0 °C at 760 mmHg
Melting Point-21°C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1467-05-6 |
| Catalog No. | 2A-9076699 |
| Chinese Name | 4-乙基苄氯 |
| Synonyms | 1-(Chloromethyl)-4-ethylbenzene; 1-(Chlormethyl)-4-ethylbenzol; MFCD00039357; 4-Ethylbenzyl chloride; p-ethylbenzylchloride |
| Molecular Formula | C9H11Cl1 |
| Molecular Weight | 154.64 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 217.1±9.0 °C at 760 mmHg |
| Melting Point | -21°C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2903999090 |
| PubChem ID | 3154468 |
| MDL Number | MFCD00039357 |
| SMILES | CCc1ccc(CCl)cc1 |
| InChI | InChI=1S/C9H11Cl/c1-2-8-3-5-9(7-10)6-4-8/h3-6H,2,7H2,1H3 |
| InChI Key | DUBCVXSYZVTCOC-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/76699_1_1467_05_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Tert-Butyl-piperidin-4-one | 1465-76-5 | 2A-9076690 |
| 2-Bromo-5-chloro-1,3-dimethylbenzene | 14659-58-6 | 2A-9076693 |
| 4-Bromophenyltrifluoromethanesulfonate | 129112-25-0 | 2A-9076694 |
| 3-Chloro-4-(trifluoromethoxy)benzonitrile | 129604-26-8 | 2A-9076697 |
| Methyl(5-hydroxymethyl)nicotinate | 129747-52-0 | 2A-9076698 |
| Ethyl4-hydrazinylbenzoate | 14685-90-6 | 2A-9076704 |
| 4-Amino-2-methyl-5-nitro-benzoicacidmethylester | 146948-44-9 | 2A-9076706 |
| But-3-Enoylchloride | 1470-91-3 | 2A-0201929 |
| 1-Benzothiophen-3(2H)-one | 130-03-0 | 2A-9076716 |
| 3-Chloropropylmethylsulfane | 13012-59-4 | 2A-9076721 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA