
CAS Number129112-25-0
Synonymso-bromophenyl triflate; 4-BROMOPHENYL TRIFLUOROMETHANESULPHONATE; 4-Bromophenyltrifluoromethanesulphonate; 2-BROMOPHENYL TRIFLUOROMETHANESULPHONATE; 4-Bromophenyltriflate; 2-bromophenyl triflate; 4-BROMOPHENYLTRIFLUOROMETHANESULFONATE; 2-bromophenyl trifluoromethanesulfonate
Molecular FormulaC7H4BrF3O3S
Molecular Weight305.07
Boiling Point15ºC
AppearanceLiquid;Light orange to Yellow to Green clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 129112-25-0 |
| Catalog No. | 2A-9076694 |
| Chinese Name | 三氟甲磺酸2-溴苯酯 |
| Synonyms | o-bromophenyl triflate; 4-BROMOPHENYL TRIFLUOROMETHANESULPHONATE; 4-Bromophenyltrifluoromethanesulphonate; 2-BROMOPHENYL TRIFLUOROMETHANESULPHONATE; 4-Bromophenyltriflate; 2-bromophenyl triflate; 4-BROMOPHENYLTRIFLUOROMETHANESULFONATE; 2-bromophenyl trifluoromethanesulfonate |
| Molecular Formula | C7H4BrF3O3S |
| Molecular Weight | 305.07 |
| Boiling Point | 15ºC |
| Appearance | Liquid;Light orange to Yellow to Green clear liquid |
| Storage Condition | room temperature, dry |
| HTC | 2906299090 |
| PubChem ID | 37403714 |
| SMILES | O=S(=O)(Oc1ccccc1Br)C(F)(F)F |
| InChI | InChI=1S/C7H4BrF3O3S/c8-5-3-1-2-4-6(5)14-15(12,13)7(9,10)11/h1-4H |
| InChI Key | ZTVGDMVHUBPFGU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2906299090 other aromatic alcohols. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methylpropane-2-sulfinamide | 146374-23-8 | 2A-9076677 |
| Methyl3-methoxy-4-Methyl-2-nitrobenzoate | 128450-32-8 | 2A-9076681 |
| 5-Methoxy-3,4-dihydro-1(2H)-isoquinolinone | 129075-49-6 | 2A-9076689 |
| 1-Tert-Butyl-piperidin-4-one | 1465-76-5 | 2A-9076690 |
| 2-Bromo-5-chloro-1,3-dimethylbenzene | 14659-58-6 | 2A-9076693 |
| 3-Chloro-4-(trifluoromethoxy)benzonitrile | 129604-26-8 | 2A-9076697 |
| Methyl(5-hydroxymethyl)nicotinate | 129747-52-0 | 2A-9076698 |
| 4-Ethylbenzylchloride | 1467-05-6 | 2A-9076699 |
| Ethyl4-hydrazinylbenzoate | 14685-90-6 | 2A-9076704 |
| 4-Amino-2-methyl-5-nitro-benzoicacidmethylester | 146948-44-9 | 2A-9076706 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA