
CAS Number129604-26-8
Synonyms3-Chloro-4-(trifluoromethoxy)benzonitrile; NCR CG DOXFFF; MFCD01631557; 3-chloro-4-trifluoromethoxy-benzonitrile
Molecular FormulaC8H3ClF3NO
Molecular Weight221.57
Density1.5±0.1 g/cm3
Boiling Point222.5±35.0 °C at 760 mmHg
Melting Point39-41ºC
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 129604-26-8 |
| Catalog No. | 2A-9076697 |
| Chinese Name | 3-氯-4-(三氟甲氧基)苯甲腈 |
| Synonyms | 3-Chloro-4-(trifluoromethoxy)benzonitrile; NCR CG DOXFFF; MFCD01631557; 3-chloro-4-trifluoromethoxy-benzonitrile |
| Molecular Formula | C8H3ClF3NO |
| Molecular Weight | 221.57 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 222.5±35.0 °C at 760 mmHg |
| Melting Point | 39-41ºC |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2926909090 |
| PubChem ID | 3209235 |
| SMILES | N#Cc1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H3ClF3NO/c9-6-3-5(4-13)1-2-7(6)14-8(10,11)12/h1-3H |
| InChI Key | ITKCOGUNHYXLND-UHFFFAOYSA-N |
| Hazard Symbols | 6.1 |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl3-methoxy-4-Methyl-2-nitrobenzoate | 128450-32-8 | 2A-9076681 |
| 5-Methoxy-3,4-dihydro-1(2H)-isoquinolinone | 129075-49-6 | 2A-9076689 |
| 1-Tert-Butyl-piperidin-4-one | 1465-76-5 | 2A-9076690 |
| 2-Bromo-5-chloro-1,3-dimethylbenzene | 14659-58-6 | 2A-9076693 |
| 4-Bromophenyltrifluoromethanesulfonate | 129112-25-0 | 2A-9076694 |
| Methyl(5-hydroxymethyl)nicotinate | 129747-52-0 | 2A-9076698 |
| 4-Ethylbenzylchloride | 1467-05-6 | 2A-9076699 |
| Ethyl4-hydrazinylbenzoate | 14685-90-6 | 2A-9076704 |
| 4-Amino-2-methyl-5-nitro-benzoicacidmethylester | 146948-44-9 | 2A-9076706 |
| But-3-Enoylchloride | 1470-91-3 | 2A-0201929 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA