
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1470-91-3 |
| Catalog No. | 2A-0201929 |
| Chinese Name | 丁-3-烯酰氯 |
| Synonyms | CH2=CH-COCl; 3-Butenoyl chloride; vinylacetic acid chloride; S14-2096; Vinylacetyl chloride; 3-Butenoicchloride; acrylic chloride |
| Molecular Formula | C4H5ClO |
| Molecular Weight | 104.53500 |
| Density | 1.065g/cm3 |
| Boiling Point | 99.545ºC at 760 mmHg |
| Storage Condition | room temperature |
| HTC | 2916190090 |
| PubChem ID | 16031880 |
| SMILES | C=CCC(=O)Cl |
| InChI | InChI=1S/C4H5ClO/c1-2-3-4(5)6/h2H,1,3H2 |
| InChI Key | OKOSPWNNXVDXKZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Chloro-4-(trifluoromethoxy)benzonitrile | 129604-26-8 | 2A-9076697 |
| Methyl(5-hydroxymethyl)nicotinate | 129747-52-0 | 2A-9076698 |
| 4-Ethylbenzylchloride | 1467-05-6 | 2A-9076699 |
| Ethyl4-hydrazinylbenzoate | 14685-90-6 | 2A-9076704 |
| 4-Amino-2-methyl-5-nitro-benzoicacidmethylester | 146948-44-9 | 2A-9076706 |
| 1-Benzothiophen-3(2H)-one | 130-03-0 | 2A-9076716 |
| 3-Chloropropylmethylsulfane | 13012-59-4 | 2A-9076721 |
| 6-Allyloxycarbonylamino-2-amino-hexanoicacid | 147529-99-5 | 2A-9076723 |
| 3-Chloropropylamine | 14753-26-5 | 2A-9076724 |
| 2,6-Dichlorophenylhydrazine | 14763-24-7 | 2A-9076728 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA