
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53130-43-1 |
| Catalog No. | 2A-9001800 |
| Chinese Name | 2,4-双(三氟甲基)苯甲酰氯 |
| Synonyms | 2,4-Bis(trifluoromethyl)benzoyl chloride; PC3103D; MFCD00061227 |
| Molecular Formula | (CF3)2C6H3COCl |
| Molecular Weight | 276.56 |
| Purity | 97 |
| Density | 1.512g/cm3 |
| Boiling Point | 191-193°C |
| Appearance | liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | II |
| EINECS | 212-322-0 |
| HTC | 2916399090 |
| PubChem ID | 24856061 |
| MDL Number | MFCD00000387 |
| SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)C(Cl)=O |
| InChI | 1S/C9H3ClF6O/c10-7(17)4-1-5(8(11,12)13)3-6(2-4)9(14,15)16/h1-3H |
| InChI Key | WAKMMQSMEDJRRI-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2593440 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/1800_1_53130_43_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,4-Bis(trifluoromethyl)benzaldehyde | 59664-42-5 | 2A-9001795 |
| 2,4-Bis(trifluoromethyl)benzamide | 53130-45-3 | 2A-9001796 |
| 2,4-Bis(trifluoromethyl)benzeneboronic acid | 153254-09-2 | 2A-9001797 |
| 2,4-Bis(trifluoromethyl)benzoic acid | 32890-87-2 | 2A-9001798 |
| 2,4-Bis(trifluoromethyl)benzonitrile | 177952-38-4 | 2A-9001799 |
| 2,4-Bis(trifluoromethyl)benzyl alcohol | 143158-15-0 | 2A-9001801 |
| 2,4-Bis(trifluoromethyl)benzyl bromide | 140690-56-8 | 2A-9001802 |
| 2,4-Bis(trifluoromethyl)benzyl chloride | 195136-46-0 | 2A-9001803 |
| 2,4-Bis(trifluoromethyl)bromobenzene | 327-75-3 | 2A-9001804 |
| 2,4-Bis(trifluoromethyl)chlorobenzene | 327-76-4 | 2A-9001805 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA