
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53130-45-3 |
| Catalog No. | 2A-9001796 |
| Chinese Name | 2,4-双(三氟甲基)苯甲酰胺 |
| Synonyms | 2,3-DIMETHYL-5-PIPERIDIN-1-YL-HEPTA-2,4,6-TRIENAL; MFCD00083536; JRD-0398; 2,4-Bis(trifluoromethyl)benzamide |
| Molecular Formula | (CF3)2C6H3CH2Br |
| Molecular Weight | 307.03 |
| Purity | 95 |
| Density | 1.468g/cm3 |
| Boiling Point | 207.4ºC at 760mmHg |
| Melting Point | 76 °C |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2924299090 |
| PubChem ID | 24857430 |
| MDL Number | MFCD00010306 |
| SMILES | FC(F)(F)c1ccc(CBr)c(c1)C(F)(F)F |
| InChI | 1S/C9H5BrF6/c10-4-5-1-2-6(8(11,12)13)3-7(5)9(14,15)16/h1-3H,4H2 |
| InChI Key | SWFFFUJOWAJJCH-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/1796_1_53130_45_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,4,6-Trimethoxybenzaldehyde | 830-79-5 | 2A-9001784 |
| 2,4,6-Trimethylphenylboronic acid | 5980-97-2 | 2A-9001791 |
| 2,4-Bis(benzyloxy)pyrimidine-5-boronic acid | 70523-24-9 | 2A-9001793 |
| 2,4-Bis(trifluoromethyl)aniline | 367-71-5 | 2A-9001794 |
| 2,4-Bis(trifluoromethyl)benzaldehyde | 59664-42-5 | 2A-9001795 |
| 2,4-Bis(trifluoromethyl)benzeneboronic acid | 153254-09-2 | 2A-9001797 |
| 2,4-Bis(trifluoromethyl)benzoic acid | 32890-87-2 | 2A-9001798 |
| 2,4-Bis(trifluoromethyl)benzonitrile | 177952-38-4 | 2A-9001799 |
| 2,4-Bis(trifluoromethyl)benzoyl chloride | 53130-43-1 | 2A-9001800 |
| 2,4-Bis(trifluoromethyl)benzyl alcohol | 143158-15-0 | 2A-9001801 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA