
CAS Number153254-09-2
Synonyms[2,4-Bis(trifluoromethyl)phenyl]boronic acid; 2,4-Bis(trifluoromethyl)benzeneboronic acid; 2,4-Bis(trifluoromethyl)phenylboronic acid; MFCD01631349
Molecular FormulaC8H5BF6O2
Molecular Weight257.93
Purity98%
Density1.5±0.1 g/cm3
Boiling Point245.4±50.0 °C at 760 mmHg
Melting Point148-150
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 153254-09-2 |
| Catalog No. | 2A-9001797 |
| Chinese Name | 2,4-双(三氟甲基)苯硼酸 |
| Synonyms | [2,4-Bis(trifluoromethyl)phenyl]boronic acid; 2,4-Bis(trifluoromethyl)benzeneboronic acid; 2,4-Bis(trifluoromethyl)phenylboronic acid; MFCD01631349 |
| Molecular Formula | C8H5BF6O2 |
| Molecular Weight | 257.93 |
| Purity | 98 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 245.4±50.0 °C at 760 mmHg |
| Melting Point | 148-150 |
| Appearance | solid |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Storage: Sealed, cool, ventilated and dry |
| HTC | 2931900090 |
| PubChem ID | 329778271 |
| MDL Number | MFCD04039321 |
| SMILES | OB(O)c1c(cccc1C(F)(F)F)C(F)(F)F |
| InChI | 1S/C8H5BF6O2/c10-7(11,12)4-2-1-3-5(8(13,14)15)6(4)9(16)17/h1-3,16-17H |
| InChI Key | WAMPGNNEOZGBHR-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| MSDS | msds/1797_1_153254_09_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,4,6-Trimethylphenylboronic acid | 5980-97-2 | 2A-9001791 |
| 2,4-Bis(benzyloxy)pyrimidine-5-boronic acid | 70523-24-9 | 2A-9001793 |
| 2,4-Bis(trifluoromethyl)aniline | 367-71-5 | 2A-9001794 |
| 2,4-Bis(trifluoromethyl)benzaldehyde | 59664-42-5 | 2A-9001795 |
| 2,4-Bis(trifluoromethyl)benzamide | 53130-45-3 | 2A-9001796 |
| 2,4-Bis(trifluoromethyl)benzoic acid | 32890-87-2 | 2A-9001798 |
| 2,4-Bis(trifluoromethyl)benzonitrile | 177952-38-4 | 2A-9001799 |
| 2,4-Bis(trifluoromethyl)benzoyl chloride | 53130-43-1 | 2A-9001800 |
| 2,4-Bis(trifluoromethyl)benzyl alcohol | 143158-15-0 | 2A-9001801 |
| 2,4-Bis(trifluoromethyl)benzyl bromide | 140690-56-8 | 2A-9001802 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA