
CAS Number32890-87-2
Synonyms2,4-Bis(trifluoromethyl)benzoicacid; 2,4-Di(trifluoromethyl)benzoic acid; MFCD00042496; FXFFR BVQ EXFFF; 2,4-Bis(trifluoromethyl)benzoic acid
Molecular FormulaC9H4F6O2
Molecular Weight258.117
Purity97%
Density1.5±0.1 g/cm3
Boiling Point219.0±40.0 °C at 760 mmHg
Melting Point109-111 °C(lit.)
AppearanceWhite to light yellow crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32890-87-2 |
| Catalog No. | 2A-9001798 |
| Chinese Name | 2,4-双(三氟甲基)苯甲酸 |
| Synonyms | 2,4-Bis(trifluoromethyl)benzoicacid; 2,4-Di(trifluoromethyl)benzoic acid; MFCD00042496; FXFFR BVQ EXFFF; 2,4-Bis(trifluoromethyl)benzoic acid |
| Molecular Formula | C9H4F6O2 |
| Molecular Weight | 258.117 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 219.0±40.0 °C at 760 mmHg |
| Melting Point | 109-111 °C(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2916399090 |
| SMILES | O=C(O)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H4F6O2/c10-8(11,12)4-1-2-5(7(16)17)6(3-4)9(13,14)15/h1-3H,(H,16,17)/p-1 |
| InChI Key | JTOIZLCQNWWDCN-UHFFFAOYSA-N |
| MSDS | msds/1798_1_32890_87_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,4-Bis(benzyloxy)pyrimidine-5-boronic acid | 70523-24-9 | 2A-9001793 |
| 2,4-Bis(trifluoromethyl)aniline | 367-71-5 | 2A-9001794 |
| 2,4-Bis(trifluoromethyl)benzaldehyde | 59664-42-5 | 2A-9001795 |
| 2,4-Bis(trifluoromethyl)benzamide | 53130-45-3 | 2A-9001796 |
| 2,4-Bis(trifluoromethyl)benzeneboronic acid | 153254-09-2 | 2A-9001797 |
| 2,4-Bis(trifluoromethyl)benzonitrile | 177952-38-4 | 2A-9001799 |
| 2,4-Bis(trifluoromethyl)benzoyl chloride | 53130-43-1 | 2A-9001800 |
| 2,4-Bis(trifluoromethyl)benzyl alcohol | 143158-15-0 | 2A-9001801 |
| 2,4-Bis(trifluoromethyl)benzyl bromide | 140690-56-8 | 2A-9001802 |
| 2,4-Bis(trifluoromethyl)benzyl chloride | 195136-46-0 | 2A-9001803 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA