
CAS Number140690-56-8
Synonyms2,4-Bis(trifluoromethyl)benzyl bromide; FXFFR B1E EXFFF; MFCD00010306; 1-(Bromomethyl)-2,4-bis(trifluoromethyl)benzene
Molecular Formula(CF3)2C6H3CH2Br
Molecular Weight307.03
Purity95%
Density1.7±0.1 g/cm3
Boiling Point185.1±35.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 140690-56-8 |
| Catalog No. | 2A-9001802 |
| Chinese Name | 2,4-双(三氟甲基)溴苄 |
| Synonyms | 2,4-Bis(trifluoromethyl)benzyl bromide; FXFFR B1E EXFFF; MFCD00010306; 1-(Bromomethyl)-2,4-bis(trifluoromethyl)benzene |
| Molecular Formula | (CF3)2C6H3CH2Br |
| Molecular Weight | 307.03 |
| Purity | 95 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 185.1±35.0 °C at 760 mmHg |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| HTC | 2903999090 |
| PubChem ID | 24857430 |
| MDL Number | MFCD00010306 |
| SMILES | FC(F)(F)c1ccc(CBr)c(c1)C(F)(F)F |
| InChI | 1S/C9H5BrF6/c10-4-5-1-2-6(8(11,12)13)3-7(5)9(14,15)16/h1-3H,4H2 |
| InChI Key | SWFFFUJOWAJJCH-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 3 |
| MSDS | msds/1802_1_140690_56_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,4-Bis(trifluoromethyl)benzeneboronic acid | 153254-09-2 | 2A-9001797 |
| 2,4-Bis(trifluoromethyl)benzoic acid | 32890-87-2 | 2A-9001798 |
| 2,4-Bis(trifluoromethyl)benzonitrile | 177952-38-4 | 2A-9001799 |
| 2,4-Bis(trifluoromethyl)benzoyl chloride | 53130-43-1 | 2A-9001800 |
| 2,4-Bis(trifluoromethyl)benzyl alcohol | 143158-15-0 | 2A-9001801 |
| 2,4-Bis(trifluoromethyl)benzyl chloride | 195136-46-0 | 2A-9001803 |
| 2,4-Bis(trifluoromethyl)bromobenzene | 327-75-3 | 2A-9001804 |
| 2,4-Bis(trifluoromethyl)chlorobenzene | 327-76-4 | 2A-9001805 |
| 2,4-Dichlorophenylboronic acid | 68716-47-2 | 2A-9001866 |
| 2,4-Difluorophenylboronic acid | 144025-03-6 | 2A-9001901 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA