
CAS Number82-75-7
Synonyms1-naphthylamine-8-sulfonic acid; EINECS 201-437-1; 8-Amino-1-naphthalenesulfonic acid; 8-Aminonaphthalene-1-sulfonic acid; Peri acid; MFCD00035730
Molecular FormulaC10H9NO3S
Molecular Weight223.25
Purity98.00%
Density1.5±0.1 g/cm3
Melting Point>350°C
AppearanceGray to reddish moist powder
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82-75-7 |
| Catalog No. | 2A-9017376 |
| Chinese Name | 周位酸 |
| Synonyms | 1-naphthylamine-8-sulfonic acid; EINECS 201-437-1; 8-Amino-1-naphthalenesulfonic acid; 8-Aminonaphthalene-1-sulfonic acid; Peri acid; MFCD00035730 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 |
| Purity | 98.00 |
| Density | 1.5±0.1 g/cm3 |
| Melting Point | >350°C |
| Appearance | Gray to reddish moist powder |
| Storage Condition | Should be sealed, dry and protected from light. Pa |
| Packaging | III |
| HTC | 2921450090 |
| MDL Number | C10H9NO3S |
| SMILES | Nc1cccc2cccc(S(=O)(=O)O)c12 |
| InChI | InChI=1S/C10H9NO3S/c11-8-5-1-3-7-4-2-6-9(10(7)8)15(12,13)14/h1-6H,11H2,(H,12,13,14) |
| InChI Key | CYJJLCDCWVZEDZ-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/17376_1_82_75_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,8-Naphthalimide | 81-83-4 | 2A-9017358 |
| 3-Bromobenzanthrone | 81-96-9 | 2A-9017363 |
| 3,9-Dibromobenzanthrone | 81-98-1 | 2A-9017364 |
| Benzanthrone | 82-05-3 | 2A-9017365 |
| Quintozine | 82-68-8 | 2A-9017374 |
| 8-Anilino-1-naphthalenesulfonic acid | 82-76-8 | 2A-9017377 |
| Methyl Green | 82-94-0 | 2A-9017379 |
| Diphenylcarbamyl chloride | 83-01-2 | 2A-9017380 |
| 4-Aminoantipyrine | 83-07-8 | 2A-0202380 |
| 2,4,6-Trihydroxybenzoic acid | 83-30-7 | 2A-9017383 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA