
CAS Number81-83-4
SynonymsNAPHTHALIMIDE; EINECS 201-379-7; Naphthalic acid imide; MFCD03265311; benzo[de]isoquinoline-1,3-dione; 1H-Benz[de]isoquinoline-1,3(2H)-dione; Naphthalene-1,8-dicarbimide; 1,8-NAPHTHALENEDICARBOXIMIDE; 1H-Benzo[de]isoquinoline-1,3(2H)-dione; 1H-Benz[de]isoquinoline-1,3; 1,8-Naphthalenediformylimine; 2,3-dihydro-1H-benzo[de]isoquinoline-1,3-dione; 1,8-Naphthalimide; 1,8-NAPHTHALIC ACID AMIDE
Molecular FormulaC12H7NO2
Molecular Weight197.19
Purity99%
Density1.4±0.1 g/cm3
Boiling Point449.1±18.0 °C at 760 mmHg
Melting Point299-300 °C (lit.)
Appearancesolid
EINECS201-379-7
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81-83-4 |
| Catalog No. | 2A-9017358 |
| Chinese Name | 1,8-萘二甲酰亚胺 |
| Synonyms | NAPHTHALIMIDE; EINECS 201-379-7; Naphthalic acid imide; MFCD03265311; benzo[de]isoquinoline-1,3-dione; 1H-Benz[de]isoquinoline-1,3(2H)-dione; Naphthalene-1,8-dicarbimide; 1,8-NAPHTHALENEDICARBOXIMIDE; 1H-Benzo[de]isoquinoline-1,3(2H)-dione; 1H-Benz[de]isoquinoline-1,3; 1,8-Naphthalenediformylimine; 2,3-dihydro-1H-benzo[de]isoquinoline-1,3-dione; 1,8-Naphthalimide; 1,8-NAPHTHALIC ACID AMIDE |
| Molecular Formula | C12H7NO2 |
| Molecular Weight | 197.19 |
| Purity | 99 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 449.1±18.0 °C at 760 mmHg |
| Melting Point | 299-300 °C (lit.) |
| Appearance | solid |
| Storage Condition | This product should be sealed and stored in a dry |
| EINECS | 201-379-7 |
| HTC | 2933990090 |
| PubChem ID | 24897515 |
| MDL Number | MFCD00006920 |
| SMILES | O=C1NC(=O)c2cccc3cccc1c23 |
| InChI | 1S/C12H7NO2/c14-11-8-5-1-3-7-4-2-6-9(10(7)8)12(15)13-11/h1-6H,(H,13,14,15) |
| InChI Key | XJHABGPPCLHLLV-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/17358_1_81_83_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Disperse Violet 28 | 81-42-5 | 2A-9017346 |
| Solvent Violet 13 | 81-48-1 | 2A-9017347 |
| Solvent Violet 47 | 81-63-0 | 2A-9017352 |
| Solvent Orange 86 | 81-64-1 | 2A-9017353 |
| Vat Blue 4 | 81-77-6 | 2A-9017355 |
| 3-Bromobenzanthrone | 81-96-9 | 2A-9017363 |
| 3,9-Dibromobenzanthrone | 81-98-1 | 2A-9017364 |
| Benzanthrone | 82-05-3 | 2A-9017365 |
| Quintozine | 82-68-8 | 2A-9017374 |
| Peri acid | 82-75-7 | 2A-9017376 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA