
CAS Number82-68-8
SynonymsFolosan (VAN); Brassicol; PCNB; Batrilex; 2,3,4,5,6-pentachloronitrobenzene; terraclor; Benzene,pentachloronitro; EINECS 201-435-0; Quintozene; Terrachlor; Quintozen; MFCD00007065; Pentachloronitrobenzene; 1,2,3,4,5-Pentachloro-6-nitrobenzene
Molecular FormulaC6Cl5NO2
Molecular Weight295.33
Purity≥94%
Density1.8±0.1 g/cm3
Boiling Point328.0±0.0 °C at 760 mmHg
Melting Point140-143 °C (lit.)
AppearanceWhite to light yellow solid
EINECS201-435-0
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82-68-8 |
| Catalog No. | 2A-9017374 |
| Chinese Name | 五氯硝基苯 |
| Synonyms | Folosan (VAN); Brassicol; PCNB; Batrilex; 2,3,4,5,6-pentachloronitrobenzene; terraclor; Benzene,pentachloronitro; EINECS 201-435-0; Quintozene; Terrachlor; Quintozen; MFCD00007065; Pentachloronitrobenzene; 1,2,3,4,5-Pentachloro-6-nitrobenzene |
| Molecular Formula | C6Cl5NO2 |
| Molecular Weight | 295.33 |
| Purity | ≥94 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 328.0±0.0 °C at 760 mmHg |
| Melting Point | 140-143 °C (lit.) |
| Appearance | White to light yellow solid |
| Water Solubility | Insoluble |
| Storage Condition | Store sealed and protected from light This product |
| Packaging | Ⅲ |
| EINECS | 201-435-0 |
| HTC | 2904909013 |
| UN(IATA) | UN 无资料 |
| PubChem ID | 24898289 |
| MDL Number | MFCD00007065 |
| SMILES | [O-][N+](=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | 1S/C6Cl5NO2/c7-1-2(8)4(10)6(12(13)14)5(11)3(1)9 |
| InChI Key | LKPLKUMXSAEKID-UHFFFAOYSA-N |
| Beilstein/REAXYS | 1914324 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 9.0 |
| MSDS | msds/17374_1_82_68_8.pdf |
| Tax Rebate | 0.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Chemical name |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Vat Blue 4 | 81-77-6 | 2A-9017355 |
| 1,8-Naphthalimide | 81-83-4 | 2A-9017358 |
| 3-Bromobenzanthrone | 81-96-9 | 2A-9017363 |
| 3,9-Dibromobenzanthrone | 81-98-1 | 2A-9017364 |
| Benzanthrone | 82-05-3 | 2A-9017365 |
| Peri acid | 82-75-7 | 2A-9017376 |
| 8-Anilino-1-naphthalenesulfonic acid | 82-76-8 | 2A-9017377 |
| Methyl Green | 82-94-0 | 2A-9017379 |
| Diphenylcarbamyl chloride | 83-01-2 | 2A-9017380 |
| 4-Aminoantipyrine | 83-07-8 | 2A-0202380 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA