
CAS Number81-98-1
Synonyms3,9-dibromo-7H-benz(de)anthracen-7-one; 2,7-Dibromomesobenzanthrone; Benzanthrone,3,9-dibromo; 3,9-dibromo-benzanthracen-7-one; 6-Bz-1-Dibrombenzanthron [Czech]; 2,7-Dibrommesobenzanthron; 3,9-Dibromobenzanthrone; EINECS 201-391-2; 6-Bz-1-dibrombenzanthron; 3.9-Dibrom-benzanthron; MFCD00021092; 3,9-dibromo-benz[de]anthracen-7-one; 3,9-Dibrombenzanthrone; 3,9-Dibrom-benz[de]anthracen-7-on
Molecular FormulaC17H8Br2O
Molecular Weight388.061
Purity98.00%
Density1.836g/cm3
Boiling Point535.5ºC at 760 mmHg
Melting Point255-256ºC
AppearanceBrown to green powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 81-98-1 |
| Catalog No. | 2A-9017364 |
| Chinese Name | 3,9-二溴苯并蒽酮 |
| Synonyms | 3,9-dibromo-7H-benz(de)anthracen-7-one; 2,7-Dibromomesobenzanthrone; Benzanthrone,3,9-dibromo; 3,9-dibromo-benzanthracen-7-one; 6-Bz-1-Dibrombenzanthron [Czech]; 2,7-Dibrommesobenzanthron; 3,9-Dibromobenzanthrone; EINECS 201-391-2; 6-Bz-1-dibrombenzanthron; 3.9-Dibrom-benzanthron; MFCD00021092; 3,9-dibromo-benz[de]anthracen-7-one; 3,9-Dibrombenzanthrone; 3,9-Dibrom-benz[de]anthracen-7-on |
| Molecular Formula | C17H8Br2O |
| Molecular Weight | 388.061 |
| Purity | 98.00 |
| Density | 1.836g/cm3 |
| Boiling Point | 535.5ºC at 760 mmHg |
| Melting Point | 255-256ºC |
| Appearance | Brown to green powder |
| HTC | 2914700090 |
| MDL Number | MFCD00021092 |
| SMILES | O=C1c2cc(Br)ccc2-c2ccc(Br)c3cccc1c23 |
| InChI | InChI=1S/C17H8Br2O/c18-9-4-5-10-11-6-7-15(19)12-2-1-3-13(16(11)12)17(20)14(10)8-9/h1-8H |
| InChI Key | XBZKJGBIPSQKAU-UHFFFAOYSA-N |
| MSDS | msds/17364_1_81_98_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Solvent Violet 47 | 81-63-0 | 2A-9017352 |
| Solvent Orange 86 | 81-64-1 | 2A-9017353 |
| Vat Blue 4 | 81-77-6 | 2A-9017355 |
| 1,8-Naphthalimide | 81-83-4 | 2A-9017358 |
| 3-Bromobenzanthrone | 81-96-9 | 2A-9017363 |
| Benzanthrone | 82-05-3 | 2A-9017365 |
| Quintozine | 82-68-8 | 2A-9017374 |
| Peri acid | 82-75-7 | 2A-9017376 |
| 8-Anilino-1-naphthalenesulfonic acid | 82-76-8 | 2A-9017377 |
| Methyl Green | 82-94-0 | 2A-9017379 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA