
CAS Number83-01-2
Synonymsdiphenyl-carbamoyl chloride; MFCD00000633; diphenyl-carbamoylchlorid; DIPHENYLUREA CHLORIDE; Diphenylcarbamylchloride; diphenylcarbamyl chloride; N,N-diphenyl-carbamoylchloride; diphenyl-carabamicchlorid; Diphenylcarbamyl chl; EINECS 201-450-2; diphenylchloroformamide; N,N-diphenylcarbamyl chloride; diphenyl-carbamicchlorid; Diphenylcarbamic chloride
Molecular Formula(C6H5)2NCOCl
Molecular Weight231.68
Purity98%
Density1.3±0.1 g/cm3
Boiling Point361.8±15.0 °C at 760 mmHg
Melting Point83-85 °C
Appearancepowder
EINECS201-450-2
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83-01-2 |
| Catalog No. | 2A-9017380 |
| Chinese Name | N,N-二苯基氯甲酰胺 |
| Synonyms | diphenyl-carbamoyl chloride; MFCD00000633; diphenyl-carbamoylchlorid; DIPHENYLUREA CHLORIDE; Diphenylcarbamylchloride; diphenylcarbamyl chloride; N,N-diphenyl-carbamoylchloride; diphenyl-carabamicchlorid; Diphenylcarbamyl chl; EINECS 201-450-2; diphenylchloroformamide; N,N-diphenylcarbamyl chloride; diphenyl-carbamicchlorid; Diphenylcarbamic chloride |
| Molecular Formula | (C6H5)2NCOCl |
| Molecular Weight | 231.68 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 361.8±15.0 °C at 760 mmHg |
| Melting Point | 83-85 °C |
| Appearance | powder |
| Water Solubility | reacts |
| Storage Condition | Should be sealed and stored in a cool and dry plac |
| Packaging | II |
| EINECS | 201-450-2 |
| HTC | 29242995 |
| PubChem ID | 24849357 |
| MDL Number | MFCD00000633 |
| SMILES | ClC(=O)N(c1ccccc1)c2ccccc2 |
| InChI | 1S/C13H10ClNO/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChI Key | XNBKKRFABABBPM-UHFFFAOYSA-N |
| Beilstein/REAXYS | 515312 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/17380_1_83_01_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: Class 8 Corrosives UN number: 3261 Proper shipping name: Corrosive solid, acidic, organic, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benzanthrone | 82-05-3 | 2A-9017365 |
| Quintozine | 82-68-8 | 2A-9017374 |
| Peri acid | 82-75-7 | 2A-9017376 |
| 8-Anilino-1-naphthalenesulfonic acid | 82-76-8 | 2A-9017377 |
| Methyl Green | 82-94-0 | 2A-9017379 |
| 4-Aminoantipyrine | 83-07-8 | 2A-0202380 |
| 2,4,6-Trihydroxybenzoic acid | 83-30-7 | 2A-9017383 |
| 1,8-Naphthosultone | 83-31-8 | 2A-9017384 |
| Deoxycholic acid | 83-44-3 | 2A-9017393 |
| 1,4-Dibromonaphthalene | 83-53-4 | 2A-9017397 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA