
CAS Number23434-88-0
Synonyms1-[5-(1,3-Benzodioxol-5-yl)pentanoyl]piperidine; Tetrahydropiperidine; 5-(1,3-Benzodioxol-5-yl)-1-(piperidin-1-yl)pentan-1-one; Tetrahydropiperin; 5-(1,3-Benzodioxol-5-yl)-1-(1-piperidinyl)-1-pentanone; Cosmoperine; Tetrahydropiperine
Molecular FormulaC17H23NO3
Molecular Weight289.369
Density1.2±0.1 g/cm3
Boiling Point469.9±24.0 °C at 760 mmHg
Melting Point41ºC
AppearanceOff-white low melting point solid with unique odor
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 23434-88-0 |
| Catalog No. | 2A-1166760 |
| Chinese Name | 四氢胡椒碱 |
| Synonyms | 1-[5-(1,3-Benzodioxol-5-yl)pentanoyl]piperidine; Tetrahydropiperidine; 5-(1,3-Benzodioxol-5-yl)-1-(piperidin-1-yl)pentan-1-one; Tetrahydropiperin; 5-(1,3-Benzodioxol-5-yl)-1-(1-piperidinyl)-1-pentanone; Cosmoperine; Tetrahydropiperine |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.369 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 469.9±24.0 °C at 760 mmHg |
| Melting Point | 41ºC |
| Appearance | Off-white low melting point solid with unique odor |
| Storage Condition | -20℃ |
| Application | Tetrahydropiperine, the cyclohexyl analog of piperine, is the first natural arylvaleramide from Piper longum. Tetrahydropiperine (compound 14) inhibits the cytochrome P450 (CYP) isoform CYP1A1/aryl hy |
| PubChem ID | 8687382 |
| SMILES | O=C(CCCCc1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C17H23NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h8-9,12H,1-7,10-11,13H2 |
| InChI Key | APZYKUZPJCQGPP-UHFFFAOYSA-N |
| Transport Info | Product name: Hydrogenated piperine |
| Related Products in Alkaloids | ||
|---|---|---|
| MONOCROTALINE | 315-22-0 | 2A-9093323 |
| 3-Chloromethcathinone Hydrochloride | 1607439-32-6 | 2A-9093527 |
| 9S-AMINO-9-DEOXYQUININE | 168960-95-0 | 2A-0150615 |
| PHYSOSTIGMINE SALICYLATE | 57-64-7 | 2A-1166692 |
| (+/-)-NICOTINE | 22083-74-5 | 2A-1166751 |
| 2-Oxaindolizidine | 6833-37-0 | 2A-1167609 |
| LAPPACONITINE HYDROBROMIDE | 97792-45-5 | 2A-1168627 |
| N-DESMETHYLGALANTHAMINE | 41303-74-6 | 2A-1170025 |
| 7-Epitaxol | 105454-04-4 | 2A-1170148 |
| SANGUINARINE (RG) | 92545-30-7 | 2A-1170446 |
| Browse all Alkaloids products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA