
CAS Number51-34-3
Synonymsl-Scopolamine; Atrochin; Transderm-V; TRANSDERM SCOP; Transcop; Skopolate; 6b,7b-Epoxy-3a-tropanyl S-(-)-Tropate; scopadulcic acid B; Skopyl; 1-METHYL-3-NONYLIMIDAZOLIUM BROMIDE, 99%; SCOP; (1R,2R,4S,5S,7s)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.0]non-7-yl (2S)-3-hydroxy-2-phenylpropanoate; Atroscine; (-)-Scopolamine; ATROQUIN; scopolamine; 6β,7β-Epoxy-3α-tropanyl S-(-)-tropate; UNII-DL48G20X8X; Scopoderm TTS; 6b,7b-Epoxy-1aH,5aH-tropan-3a-ol (-)-Tropate; Scopoderm; (−)-Scopolamine; Scopine tropate; EINECS 200-090-3
Molecular FormulaC17H21NO4
Molecular Weight384.26
Purity98.00%
Density1.3±0.1 g/cm3
Boiling Point460.3±45.0 °C at 760 mmHg
Melting Point59ºC
Appearanceliquid
EINECS200-090-3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 51-34-3 |
| Catalog No. | 2A-0202158 |
| Chinese Name | 东莨菪碱 |
| Synonyms | l-Scopolamine; Atrochin; Transderm-V; TRANSDERM SCOP; Transcop; Skopolate; 6b,7b-Epoxy-3a-tropanyl S-(-)-Tropate; scopadulcic acid B; Skopyl; 1-METHYL-3-NONYLIMIDAZOLIUM BROMIDE, 99%; SCOP; (1R,2R,4S,5S,7s)-9-Methyl-3-oxa-9-azatricyclo[3.3.1.0]non-7-yl (2S)-3-hydroxy-2-phenylpropanoate; Atroscine; (-)-Scopolamine; ATROQUIN; scopolamine; 6β,7β-Epoxy-3α-tropanyl S-(-)-tropate; UNII-DL48G20X8X; Scopoderm TTS; 6b,7b-Epoxy-1aH,5aH-tropan-3a-ol (-)-Tropate; Scopoderm; (−)-Scopolamine; Scopine tropate; EINECS 200-090-3 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 384.26 |
| Purity | 98.00 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 460.3±45.0 °C at 760 mmHg |
| Melting Point | 59ºC |
| Appearance | liquid |
| Storage Condition | Warehouse is low temperature, ventilated and dry |
| Application | Scopolamine is a high affinity (nM range) muscarinic antagonist. Scopolamine reversibly inhibits 5-HT3 receptor responses with an IC50 of 2.09 μM. |
| EINECS | 200-090-3 |
| SMILES | [Br].N1([C@@H]2[C@@H]3O[C@@H]3[C@@H]1CC(C2)OC(=O)[C@H](CO)c4ccccc4)C |
| InChI | 1S/C17H21NO4.Br/c1-18-13-7-11(8-14(18)16-15(13)22-16)21-17(20)12(9-19)10-5-3-2-4-6-10;/h2-6,11-16,19H,7-9H2,1H3;/t11?,12-,13+,14+,15-,16+;/m1./s1 |
| InChI Key | XUZPYCBMTSSDHK-AKTDCHNFSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/16599_1_51_34_3.pdf |
| Transport Info | Product name: Scopolamine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| D(+)-Glucose | 50-99-7 | 2A-9016588 |
| Piperonyl butoxide | 51-03-6 | 2A-9016589 |
| Procaine hydrochloride | 51-05-8 | 2A-9016590 |
| Tiratricol | 51-24-1 | 2A-9016596 |
| Isoprenaline hydrochloride | 51-30-9 | 2A-9016598 |
| Epinephrine bitartrate | 51-42-3 | 2A-9016603 |
| L(-)-Epinephrine | 51-43-4 | 2A-9016604 |
| 3,4-Dichlorobenzoic acid | 51-44-5 | 2A-9016605 |
| Histamine | 51-45-6 | 2A-9016606 |
| L-Thyroxine | 51-48-9 | 2A-9016607 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA