
CAS Number5578-73-4
SynonymsSanguinarine chloride; Sanguinarine chloride hydrate; 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-13-ium chloride; 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium chloride; 13-Methyl[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridin-13-ium chloride; [1,3]Benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium, 13-methyl-, chloride (1:1); sanguinarine; 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium chloride (1:1); chlorure de sanguinarium; sanguinarium chloride; 13-Methyl[1,3]dioxolo[4,5]benzo[1,2-c][1,3]dioxolo[4,5-i]phenanthridin-13-iumchlorid; Sanguinarine (chloride)
Molecular FormulaC20H14ClNO4
Molecular Weight367.79
Purity40%-42%
Melting Point287-289 ºC
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5578-73-4 |
| Catalog No. | 2A-9012387 |
| Chinese Name | 盐酸血根碱 |
| Synonyms | Sanguinarine chloride; Sanguinarine chloride hydrate; 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridin-13-ium chloride; 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium chloride; 13-Methyl[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridin-13-ium chloride; [1,3]Benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium, 13-methyl-, chloride (1:1); sanguinarine; 13-methyl[1,3]benzodioxolo[5,6-c]-1,3-dioxolo[4,5-i]phenanthridinium chloride (1:1); chlorure de sanguinarium; sanguinarium chloride; 13-Methyl[1,3]dioxolo[4,5]benzo[1,2-c][1,3]dioxolo[4,5-i]phenanthridin-13-iumchlorid; Sanguinarine (chloride) |
| Molecular Formula | C20H14ClNO4 |
| Molecular Weight | 367.79 |
| Purity | 40%-42 |
| Melting Point | 287-289 ºC |
| Appearance | white powder |
| Water Solubility | methanol: 20 mg/mL, clear, orange |
| Storage Condition | Store at +4°C |
| Application | Sanguinarine chloride is an alkaloid derived from Sanguinaria Canadensis that stimulates apoptosis by activating the production of reactive oxygen species (ROS). Sanguinarine-induced apoptosis is asso |
| MDL Number | C20H14ClNO4 |
| SMILES | C[n+]1cc2c3c(ccc2c2ccc4cc5c(cc4c21)OCO5)OCO3.[Cl-] |
| InChI | InChI=1S/C20H14NO4.ClH/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21;/h2-8H,9-10H2,1H3;1H/q+1;/p-1 |
| InChI Key | GIZKAXHWLRYMLE-UHFFFAOYSA-M |
| MSDS | msds/12387_1_5578_73_4.pdf |
| Transport Info | Product Name: Sanguinaris Hydrate |
| Related Products in Alkaloids | ||
|---|---|---|
| Palmatine | 3486-67-7 | 2A-9011856 |
| Physostigmine | 57-47-6 | 2A-9012001 |
| Quinidine | 56-54-2 | 2A-9012238 |
| Quinine sulfate | 804-63-7 | 2A-9012239 |
| Rescinnamine | 24815-24-5 | 2A-9012288 |
| Sanguinarine HCl dihydrate | 2A-303472 | 2A-9012388 |
| Swainsonine | 72741-87-8 | 2A-9012557 |
| Theobromine | 83-67-0 | 2A-9012675 |
| Pseudoephedrine sulphate | 7460-12-0 | 2A-9015492 |
| Reserpine | 50-55-5 | 2A-9016563 |
| Browse all Alkaloids products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA