
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 26652-09-5 |
| Catalog No. | 2A-9012319 |
| Chinese Name | 利托菌 |
| Synonyms | ritodrine; Ritodrina; Ritodrinium; Prepar |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 323.81 |
| Purity | 98 |
| Density | 1.213g/cm3 |
| Boiling Point | 512.3ºC at 760mmHg |
| Appearance | solid |
| Storage Condition | Room temperature, sealed, dry |
| Application | Ritodrine (DU21220) is a β-adrenergic agonist and an effective uterine relaxant that can be used in research to prevent premature birth [1][2]. |
| EINECS | 245-514-8 |
| MDL Number | MFCD01657514 |
| SMILES | Cl.C[C@H](NCCc1ccc(O)cc1)[C@H](O)c2ccc(O)cc2 |
| InChI | 1S/C17H21NO3.ClH/c1-12(17(21)14-4-8-16(20)9-5-14)18-11-10-13-2-6-15(19)7-3-13;/h2-9,12,17-21H,10-11H2,1H3;1H/t12-,17-;/m0./s1 |
| InChI Key | IDLSITKDRVDKRV-XHXSRVRCSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/12319_1_26652_09_5.pdf |
| Transport Info | Product name: Litobacterium |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ripisartan | 148504-51-2 | 2A-9012313 |
| Risotilide | 120688-08-6 | 2A-9012315 |
| Risperidal | 106266-06-2 | 2A-9012316 |
| Ristianol | 78092-65-6 | 2A-9012317 |
| Ritanserin | 87051-43-2 | 2A-9012318 |
| Ritodrine hydrochloride | 23239-51-2 | 2A-9012320 |
| Robenidine | 25875-51-8 | 2A-9012326 |
| Robenidine Hydrochloride | 25875-50-7 | 2A-9012327 |
| Rocuronium bromide | 119302-91-9 | 2A-9012329 |
| Roflumilast | 162401-32-3 | 2A-9012331 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA