
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 60-40-2 |
| Catalog No. | 2A-9011301 |
| Chinese Name | 异莰胺 |
| Synonyms | EINECS 200-476-1 |
| Molecular Formula | C11H21N |
| Molecular Weight | 203.75 |
| Purity | 98.00 |
| Density | 0.91 |
| Boiling Point | 189.3ºC at 760 mmHg |
| Melting Point | 245-256ºC |
| Storage Condition | This product should be kept sealed. |
| Application | Mecamylamine is an orally active, non-selective, non-competitive nAChR antagonist. Alpha amylase is also a ganglion blocking agent. Alpha amylase can cross the blood-brain barrier. Alpha-amylase can b |
| PubChem ID | 329750330 |
| MDL Number | MFCD00151462 |
| SMILES | Cl.[H][C@@]12CC[C@@]([H])(C1)C(C)(NC)C2(C)C |
| InChI | 1S/C11H21N.ClH/c1-10(2)8-5-6-9(7-8)11(10,3)12-4;/h8-9,12H,5-7H2,1-4H3;1H/t8-,9+,11?;/m1./s1 |
| InChI Key | PKVZBNCYEICAQP-CIISUUNXSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/11301_1_60_40_2.pdf |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Matrinium | 519-02-8 | 2A-9011296 |
| Mazindol | 22232-71-9 | 2A-9011297 |
| Mazokalim | 164178-54-5 | 2A-9011298 |
| Mebeverine | 3625-06-7 | 2A-9011299 |
| Mecamylamine | 826-39-1 | 2A-9011300 |
| Mecillinam | 79580-20-4 | 2A-9011302 |
| Mecinarone | 26225-59-2 | 2A-9011303 |
| Meclizine hydrochloride | 1104-22-9 | 2A-9011304 |
| Meclofenamate sodium | 6385-02-0 | 2A-9011305 |
| Meclofenoxate hydrochloride | 3685-84-5 | 2A-9011306 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA