
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 210353-53-0 |
| Catalog No. | 2A-9010707 |
| Chinese Name | 甲磺酸吉米沙星 |
| Synonyms | Gemifloxacin Mesilate; Gemifioxacin Mesylate; MFCD08277637; gemifioxacin |
| Molecular Formula | C19H24FN5O7S |
| Molecular Weight | 485.49 |
| Purity | ≥98 (HPLC) |
| Boiling Point | 638.9ºC at 760mmHg |
| Melting Point | 235-237ºC |
| Appearance | powder |
| Storage Condition | -20°C Freezer |
| Application | Gemifloxacin mesylate is an oral broad-spectrum quinolone antibacterial agent used to treat acute bacterial attacks of chronic bronchitis and mild to moderate pneumonia. |
| PubChem ID | 329825509 |
| MDL Number | MFCD08277637 |
| SMILES | CS(=O)(O)=O.OC(C1=CN(C2CC2)C3=NC(N4C/C(C(CN)C4)=N\OC)=C(F)C=C3C1=O)=O |
| InChI | 1S/C18H20FN5O4.CH4O3S/c1-28-22-14-8-23(6-9(14)5-20)17-13(19)4-11-15(25)12(18(26)27)7-24(10-2-3-10)16(11)21-17;1-5(2,3)4/h4,7,9-10H,2-3,5-6,8,20H2,1H3,(H,26,27);1H3,(H,2,3,4)/b22-14+; |
| InChI Key | JIYMVSQRGZEYAX-CWUUNJJBSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/10707_1_210353_53_0.pdf |
| Transport Info | Product name: Gemifloxacin mesylate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Gastric mucin | 53-46-3 | 2A-9010697 |
| Geclosporin | 74436-00-3 | 2A-9010699 |
| Gedocarnil | 109623-97-4 | 2A-9010700 |
| Geldanamycin | 30562-34-6 | 2A-9010702 |
| Gemcadiol | 35449-36-6 | 2A-9010703 |
| Geneticin | 49863-47-0 | 2A-9010709 |
| Genipin | 6902-77-8 | 2A-9010710 |
| Geniposide | 24512-63-8 | 2A-9010711 |
| Geniposidic acid | 27741-01-1 | 2A-9010712 |
| Gepefrine | 18840-47-6 | 2A-9010717 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA