
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 27741-01-1 |
| Catalog No. | 2A-9010712 |
| Chinese Name | 京尼平苷酸 |
| Synonyms | Geniposidinsaeure; geniposidic acid |
| Molecular Formula | C16H22O10 |
| Molecular Weight | 374.34 |
| Purity | ≥90.0 (HPLC) |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 684.1±55.0 °C at 760 mmHg |
| Storage Condition | 2~8℃ |
| Application | Geniposidic acid has radiation protection and anti-cancer activity. |
| MDL Number | MFCD00210294 |
| SMILES | O[C@@H]1[C@@H](CO)O[C@@H](O[C@H]2[C@@](C(CO)=CC3)([H])[C@@]3([H])C(C(O)=O)=CO2)[C@H](O)[C@H]1O |
| InChI | 1S/C16H22O10/c17-3-6-1-2-7-8(14(22)23)5-24-15(10(6)7)26-16-13(21)12(20)11(19)9(4-18)25-16/h1,5,7,9-13,15-21H,2-4H2,(H,22,23)/t7-,9-,10-,11-,12+,13-,15+,16+/m1/s1 |
| InChI Key | ZJDOESGVOWAULF-OGJQONSISA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/10712_1_27741_01_1.pdf |
| Transport Info | Product name: Geniposidic acid |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Gemcadiol | 35449-36-6 | 2A-9010703 |
| Gemifioxacin mesylate | 210353-53-0 | 2A-9010707 |
| Geneticin | 49863-47-0 | 2A-9010709 |
| Genipin | 6902-77-8 | 2A-9010710 |
| Geniposide | 24512-63-8 | 2A-9010711 |
| Gepefrine | 18840-47-6 | 2A-9010717 |
| Geraldol | 21511-25-1 | 2A-9010718 |
| Geroquinol | 10457-66-6 | 2A-9010719 |
| Gestonorone caproate | 1253-28-7 | 2A-9010721 |
| Ginkgo biloba | 90045-36-6 | 2A-9010723 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA