
CAS Number2612-33-1
SynonymsClonitrate (USAN/INN); 3-chloropropane-1,2-diol dinitrate; 1,2-Propanediol, 3-chloro-, dinitrate; clonitrate; Dinitrochlorhydrin; 3-Chlor-1,2-di(nitryloxy)propan; 1-Chlor-2,3-bis-nitryloxy-propan; Clonitrato; 1-chloro-2,3-bis-nitrooxy-propane; Clonitratum; 3-Chloropropane-1,2-diyl dinitrate; 3-Chloro-1,2-propanediyl dinitrate; Salpetersaeure-(3-chlor-propylenester); 1-chloro-2,3-bis-nitryloxy-propane; 3-Chlor-propylenglykol-dinitrat
Molecular FormulaC3H5ClN2O6
Molecular Weight200.535
Purity98%
Density1.6±0.1 g/cm3
Boiling Point250.9±20.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2612-33-1 |
| Catalog No. | 2A-9009865 |
| Chinese Name | 氯硝甘油 |
| Synonyms | Clonitrate (USAN/INN); 3-chloropropane-1,2-diol dinitrate; 1,2-Propanediol, 3-chloro-, dinitrate; clonitrate; Dinitrochlorhydrin; 3-Chlor-1,2-di(nitryloxy)propan; 1-Chlor-2,3-bis-nitryloxy-propan; Clonitrato; 1-chloro-2,3-bis-nitrooxy-propane; Clonitratum; 3-Chloropropane-1,2-diyl dinitrate; 3-Chloro-1,2-propanediyl dinitrate; Salpetersaeure-(3-chlor-propylenester); 1-chloro-2,3-bis-nitryloxy-propane; 3-Chlor-propylenglykol-dinitrat |
| Molecular Formula | C3H5ClN2O6 |
| Molecular Weight | 200.535 |
| Purity | 98 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 250.9±20.0 °C at 760 mmHg |
| HTC | 2920909090 |
| SMILES | O=[N+]([O-])OCC(CCl)O[N+](=O)[O-] |
| InChI | InChI=1S/C3H5ClN2O6/c4-1-3(12-6(9)10)2-11-5(7)8/h3H,1-2H2 |
| InChI Key | SUAJWTBTMNHVBZ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Clofilium phosphate | 68379-03-3 | 2A-9009859 |
| Clomifene citrate | 50-41-9 | 2A-9009860 |
| Clomoxir | 88431-47-4 | 2A-9009861 |
| Clonazoline | 17692-28-3 | 2A-9009863 |
| Clonidine | 4205-90-7 | 2A-9009864 |
| Clonixin | 17737-65-4 | 2A-9009866 |
| Clopamide | 636-54-4 | 2A-9009867 |
| Cloperastine | 3703-76-2 | 2A-9009868 |
| Cloperastine hydrochloride | 14984-68-0 | 2A-9009869 |
| Clopidol | 2971-90-6 | 2A-9009872 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA