
CAS Number61-75-6
SynonymsBretylium Tosilate; EINECS 200-516-8; bretylan; Bretylium Tosylate; N-(2-Bromobenzyl)-N,N-dimethylethanaminium 4-methylbenzenesulfonate; N-[(2-bromophenyl)methyl]-N,N-dimethylethanaminium 4-methylbenzenesulfonate; (2-bromophenyl)methyl-ethyl-dimethylazanium,4-methylbenzenesulfonate; bretilium tosilate; MFCD00038731; Bretylium (tosylate)
Molecular FormulaC18H24BrNO3S
Molecular Weight414.36
Purity98%
Melting Point97-99°
Appearancewhite
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61-75-6 |
| Catalog No. | 2A-9009435 |
| Chinese Name | 托西溴苄铵 |
| Synonyms | Bretylium Tosilate; EINECS 200-516-8; bretylan; Bretylium Tosylate; N-(2-Bromobenzyl)-N,N-dimethylethanaminium 4-methylbenzenesulfonate; N-[(2-bromophenyl)methyl]-N,N-dimethylethanaminium 4-methylbenzenesulfonate; (2-bromophenyl)methyl-ethyl-dimethylazanium,4-methylbenzenesulfonate; bretilium tosilate; MFCD00038731; Bretylium (tosylate) |
| Molecular Formula | C18H24BrNO3S |
| Molecular Weight | 414.36 |
| Purity | 98 |
| Melting Point | 97-99° |
| Appearance | white |
| Water Solubility | H2O: soluble50mg/mL |
| Storage Condition | This product should be sealed and stored in a dry |
| Application | Bretylium (tosylate) is an inhibitor of presynaptic release of vasoconstrictive neurotransmitters and a blocker of sympathetic and adrenergic nerves. |
| PubChem ID | 329749129 |
| MDL Number | MFCD00038731 |
| SMILES | Cc1ccc(cc1)S([O-])(=O)=O.CC[N+](C)(C)Cc2ccccc2Br |
| InChI | 1S/C11H17BrN.C7H8O3S/c1-4-13(2,3)9-10-7-5-6-8-11(10)12;1-6-2-4-7(5-3-6)11(8,9)10/h5-8H,4,9H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChI Key | KVWNWTZZBKCOPM-UHFFFAOYSA-M |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/9435_1_61_75_6.pdf |
| Transport Info | Product name: Tositrimonium bromide |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bornaprolol | 66451-06-7 | 2A-9009429 |
| Bornelone | 2226-11-1 | 2A-9009430 |
| Bosentan | 147536-97-8 | 2A-9009432 |
| Boxidine | 10355-14-3 | 2A-9009433 |
| Brefonalol | 104051-20-9 | 2A-9009434 |
| Brilliant green | 633-03-4 | 2A-9009436 |
| Brimonidine | 59803-98-4 | 2A-9009437 |
| Brimonidinne tartrate | 70359-46-5 | 2A-9009438 |
| Brinazarone | 89622-90-2 | 2A-9009439 |
| Brinzolamide | 138890-62-7 | 2A-9009440 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA