
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 16269-05-9 |
| Catalog No. | 2A-9094094 |
| Chinese Name | 9-氧代-9-苯基壬酸 |
| Synonyms | 9-Phenyl-7-oxo-nonansaeure; 7-Keto-9-phenylnonansaeure; Benzenenonanoic acid,z-oxo; 7-Keto-9-phenylnonanoic acid; 8-Benzoyloctanoic acid |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.31700 |
| Purity | 98 |
| Density | 1.074g/cm3 |
| Boiling Point | 418.7ºC at 760 mmHg |
| HTC | 2918300090 |
| PubChem ID | 432900 |
| InChI | InChI=1S/C15H20O3/c16-14(13-9-5-4-6-10-13)11-7-2-1-3-8-12-15(17)18/h4-6,9-10H,1-3,7-8,11-12H2,(H,17,18) |
| InChI Key | BFUPULAAJVYXRI-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(5-broMo-2-chlorobenzyl)phenol | 864070-18-8 | 2A-9094088 |
| Indene-C60 bisadduct | 1207461-57-1 | 2A-9094090 |
| 5-BENZOYLPENTANOIC ACID | 4144-62-1 | 2A-9094091 |
| 6-BENZOYLHEXANOIC ACID | 7472-43-7 | 2A-9094092 |
| 7-BENZOYLHEPTANOIC ACID | 24314-23-6 | 2A-9094093 |
| XYLAN | 9014-63-5 | 2A-9094096 |
| 17-OCTADECYNOIC ACID | 34450-18-5 | 2A-9094097 |
| 4-NITRO-3-(OCTANOYLOXY)BENZOIC ACID | 55894-52-5 | 2A-9094098 |
| 6-Feruloylspinosin | 77690-92-7 | 2A-9094100 |
| 1,4-PREGNADIEN-11-BETA, 17,21-TRIOL-3,20-DIONE 17-VALERATE-21-ACETATE | 15180-00-4 | 2A-9094101 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA