
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 77690-92-7 |
| Catalog No. | 2A-9094100 |
| Chinese Name | 6'''-阿魏酰斯皮诺素 |
| Synonyms | 6'''-Feruloylspinosin |
| Molecular Formula | C38H40O18 |
| Molecular Weight | 784.72 |
| Purity | 98.00 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1029.8±65.0 °C at 760 mmHg |
| Storage Condition | -20℃ |
| Application | 6‴-Feruloylspinosin is a flavonoid isolated from Ziziphus jujuba seeds. In rat hippocampal neurons, 6‴-Feruloylspinosin can penetrate the blood-brain barrier and enhance the mRNA expression of GABAAα1 |
| PubChem ID | 36562383 |
| MDL Number | MFCD28964219 |
| SMILES | COc1cc(C=CC(=O)OCC2OC(OC3C(c4c(OC)cc5oc(-c6ccc(O)cc6)cc(=O)c5c4O)OC(CO)C(O)C3O)C(O)C(O)C2O)ccc1O |
| InChI | InChI=1S/C38H40O18/c1-50-22-11-16(3-9-19(22)41)4-10-27(43)52-15-26-31(45)33(47)35(49)38(55-26)56-37-34(48)30(44)25(14-39)54-36(37)29-23(51-2)13-24-28(32(29)46)20(42)12-21(53-24)17-5-7-18(40)8-6-17/h3-13,25-26,30-31,33-41,44-49H,14-15H2,1-2H3/b10-4+/t25-,26-,30-,31-,33+,34+,35-,36+,37-,38+/m1/s1 |
| InChI Key | WZAXZHIVHPRTIU-IHIXZLSHSA-N |
| MSDS | msds/94100_1_77690_92_7.pdf |
| Transport Info | Product name: 6''-feruloyl spinosin |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-BENZOYLHEPTANOIC ACID | 24314-23-6 | 2A-9094093 |
| 8-Benzoyloctanoicacid | 16269-05-9 | 2A-9094094 |
| XYLAN | 9014-63-5 | 2A-9094096 |
| 17-OCTADECYNOIC ACID | 34450-18-5 | 2A-9094097 |
| 4-NITRO-3-(OCTANOYLOXY)BENZOIC ACID | 55894-52-5 | 2A-9094098 |
| 1,4-PREGNADIEN-11-BETA, 17,21-TRIOL-3,20-DIONE 17-VALERATE-21-ACETATE | 15180-00-4 | 2A-9094101 |
| 11beta,17,21-trihydroxypregna-1,4-diene-3,20-dione 21-valerate | 39791-31-6 | 2A-9094103 |
| Caraway, ext. | 85940-31-4 | 2A-9094106 |
| 2,3-diphosphonooxypropanoic acid | 138-81-8 | 2A-9094108 |
| 1,2,3,4-Tetrachlorobenzene | 634-66-2 | 2A-9094110 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA