
CAS Number7472-43-7
SynonymsMFCD00039608; Benzeneheptanoic acid,|AE-oxo; BEN103; 7-Oxo-7-phenyl-heptansaeure; Benzeneheptanoic acid,z-oxo; 6-benzoylhexanoic acid; 7-oxo-7-phenyl-heptanoic acid
Molecular FormulaC13H16O3
Molecular Weight220.27
Purity98%
Density1.111g/cm3
Boiling Point396ºC at 760mmHg
Melting Point83-86°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7472-43-7 |
| Catalog No. | 2A-9094092 |
| Chinese Name | 6-苯酰己酸 |
| Synonyms | MFCD00039608; Benzeneheptanoic acid,|AE-oxo; BEN103; 7-Oxo-7-phenyl-heptansaeure; Benzeneheptanoic acid,z-oxo; 6-benzoylhexanoic acid; 7-oxo-7-phenyl-heptanoic acid |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 |
| Purity | 98 |
| Density | 1.111g/cm3 |
| Boiling Point | 396ºC at 760mmHg |
| Melting Point | 83-86°C |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2918300090 |
| PubChem ID | 472757 |
| MDL Number | MFCD00039608 |
| SMILES | O=C(O)CCCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16O3/c14-12(11-7-3-1-4-8-11)9-5-2-6-10-13(15)16/h1,3-4,7-8H,2,5-6,9-10H2,(H,15,16) |
| InChI Key | DOQWHEUDAHLEPT-UHFFFAOYSA-N |
| MSDS | msds/94092_1_7472_43_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| formebolone | 2454-11-7 | 2A-9094082 |
| formebolone | 96301-34-7 | 2A-9094083 |
| 4-(5-broMo-2-chlorobenzyl)phenol | 864070-18-8 | 2A-9094088 |
| Indene-C60 bisadduct | 1207461-57-1 | 2A-9094090 |
| 5-BENZOYLPENTANOIC ACID | 4144-62-1 | 2A-9094091 |
| 7-BENZOYLHEPTANOIC ACID | 24314-23-6 | 2A-9094093 |
| 8-Benzoyloctanoicacid | 16269-05-9 | 2A-9094094 |
| XYLAN | 9014-63-5 | 2A-9094096 |
| 17-OCTADECYNOIC ACID | 34450-18-5 | 2A-9094097 |
| 4-NITRO-3-(OCTANOYLOXY)BENZOIC ACID | 55894-52-5 | 2A-9094098 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA