
CAS Number485-31-4
Synonyms2-sec-Butyl-4,6-dinitrophenyl 3-methylbut-2-enoate; Morocide; MFCD00055425; 2-(1-methylpropyl)-4,6-dinitrophenyl 3-methyl-2-butenoate; Caswell No. 086; Dinoseb methacrylate; 4,6-dinitro-2-sec.-butylphenyl 3,3-dimethylacrylate; 2-sec-Butyl-4,6-dinitrophenyl 3,3-Dimethylacrylate; 2-sec-butyl-4,6-dinitrophenyl-3,3-dimethylacrylate; Dapacryl; Morrocid; EINECS 207-612-9; 2-Butenoic acid, 3-methyl-, 2-(1-methylpropyl)-4,6-dinitrophenyl ester; 2-sec-Butyl-4,6-dinitrophenyl 3-methyl-2-butenoate; Binapacryl; (2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate; 2-(butan-2-yl)-4,6-dinitrophenyl 3-methylbut-2-enoate; (RS)-2-sec-butyl-4,6-dinitrophenyl 3-methylcrotonate; 2,4-dinitro-6-sec-butylphenyldimethyl-acrylate; Endosan; 4,6-Dinitro-2-sec-butylphenyl b,b-Dimethylacrylate; rac-2-[(2R)-butan-2-yl
Molecular FormulaC15H18N2O6
Molecular Weight322.31
Purity98%
Density1.2±0.1 g/cm3
Boiling Point436.7±45.0 °C at 760 mmHg
Melting Point68-69ºC
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 485-31-4 |
| Catalog No. | 2A-9009406 |
| Chinese Name | 乐杀螨 |
| Synonyms | 2-sec-Butyl-4,6-dinitrophenyl 3-methylbut-2-enoate; Morocide; MFCD00055425; 2-(1-methylpropyl)-4,6-dinitrophenyl 3-methyl-2-butenoate; Caswell No. 086; Dinoseb methacrylate; 4,6-dinitro-2-sec.-butylphenyl 3,3-dimethylacrylate; 2-sec-Butyl-4,6-dinitrophenyl 3,3-Dimethylacrylate; 2-sec-butyl-4,6-dinitrophenyl-3,3-dimethylacrylate; Dapacryl; Morrocid; EINECS 207-612-9; 2-Butenoic acid, 3-methyl-, 2-(1-methylpropyl)-4,6-dinitrophenyl ester; 2-sec-Butyl-4,6-dinitrophenyl 3-methyl-2-butenoate; Binapacryl; (2-butan-2-yl-4,6-dinitrophenyl) 3-methylbut-2-enoate; 2-(butan-2-yl)-4,6-dinitrophenyl 3-methylbut-2-enoate; (RS)-2-sec-butyl-4,6-dinitrophenyl 3-methylcrotonate; 2,4-dinitro-6-sec-butylphenyldimethyl-acrylate; Endosan; 4,6-Dinitro-2-sec-butylphenyl b,b-Dimethylacrylate; rac-2-[(2R)-butan-2-yl |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.31 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 436.7±45.0 °C at 760 mmHg |
| Melting Point | 68-69ºC |
| Storage Condition | This product should be sealed and stored away from |
| Packaging | III |
| MDL Number | MFCD00055425 |
| SMILES | CCC(C)c1cc(cc(c1OC(=O)\C=C(/C)C)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C15H18N2O6/c1-5-10(4)12-7-11(16(19)20)8-13(17(21)22)15(12)23-14(18)6-9(2)3/h6-8,10H,5H2,1-4H3 |
| InChI Key | ZRDUSMYWDRPZRM-UHFFFAOYSA-N |
| Beilstein/REAXYS | 2013712 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/9406_1_485_31_4.pdf |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Bietaserpine | 53-18-9 | 2A-9009399 |
| Bifemelane | 90293-01-9 | 2A-9009400 |
| Bifenox | 42576-02-3 | 2A-9009401 |
| Bilirubin | 635-65-4 | 2A-9009403 |
| Bimakalim | 117545-11-6 | 2A-9009405 |
| Bindarit | 130641-38-2 | 2A-9009407 |
| Bioresmethrin | 28434-01-7 | 2A-9009408 |
| Biphenamine | 3572-52-9 | 2A-9009409 |
| Bis(tricyclohexyltin) sulfide | 13121-76-1 | 2A-9009410 |
| Bisacodyl | 603-50-9 | 2A-9009411 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA