
CAS Number56216-10-5
Synonymsmethyl 3-([1,1'-biphenyl]-4-yl)-3-oxopropanoate; p-phenylbenzoyl acetic acid methyl ester; methyl 3-biphenyl-4-yl-3-oxo-propionate; methyl-4-phenylbenzoylacetate; p-Phenylbenzoyl-essigsaeure-methylester; methyl 3-biphenyl-4-yl-3-oxopropanoate; 3-Biphenyl-4-yl-3-oxopropionic acid methyl ester
Molecular FormulaC21H16N2O4
Molecular Weight360.373
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56216-10-5 |
| Catalog No. | 2A-9088666 |
| Chinese Name | 3-二苯基-4-基-3-氧-丙 酸 甲基 酯 |
| Synonyms | methyl 3-([1,1'-biphenyl]-4-yl)-3-oxopropanoate; p-phenylbenzoyl acetic acid methyl ester; methyl 3-biphenyl-4-yl-3-oxo-propionate; methyl-4-phenylbenzoylacetate; p-Phenylbenzoyl-essigsaeure-methylester; methyl 3-biphenyl-4-yl-3-oxopropanoate; 3-Biphenyl-4-yl-3-oxopropionic acid methyl ester |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.373 |
| HTC | 2918300090 |
| MDL Number | MFCD00706442 |
| SMILES | COC(=O)CC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI Key | TYIZFWZJRSSQBB-UHFFFAOYSA-N |
| MSDS | msds/88666_1_56216_10_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Biphenyl-3-yl-3-oxo-propionicacidethylester | 677326-79-3 | 2A-9088660 |
| 2-Chloro-4-fluorobenzylAlcohol | 208186-84-9 | 2A-9088661 |
| 3-Biphenyl-4-yl-3-oxo-propionicacidethylester | 57477-98-2 | 2A-9088662 |
| 3-Biphenyl-2-yl-3-oxo-propionicacidmethylester | 677326-71-5 | 2A-9088663 |
| 3-Biphenyl-3-yl-3-oxo-propionicacidmethylester | 677326-70-4 | 2A-9088665 |
| (Biphenyl-4-yloxy)aceticacid | 13333-86-3 | 2A-9088667 |
| 1,3-Bis(carbomethoxy)tetramethyldisiloxane | 204641-76-9 | 2A-9088669 |
| 2,7-Bis-ethoxycarbonyloctanedioicaciddiethylester | 5394-84-3 | 2A-9088672 |
| 3-(2-Bromophenyl)-3-oxo-propionicacidmethylester | 294881-08-6 | 2A-9088675 |
| 3-(3-Bromo-phenyl)-3-oxo-propionicacidmethylester | 294881-10-0 | 2A-9088677 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA