
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13333-86-3 |
| Catalog No. | 2A-9088667 |
| Chinese Name | (4-联苯氧基)乙酸 |
| Synonyms | (4-Biphenylyloxy)acetic acid; (biphenyl-4-yloxy)acetic acid; 2-(4-phenylphenoxy)acetic acid; MFCD00179413 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 409.4±28.0 °C at 760 mmHg |
| HTC | 2918990090 |
| MDL Number | MFCD00179413 |
| SMILES | O=C(O)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O3/c15-14(16)10-17-13-8-6-12(7-9-13)11-4-2-1-3-5-11/h1-9H,10H2,(H,15,16)/p-1 |
| InChI Key | UEXMWDXKHUIBSJ-UHFFFAOYSA-N |
| MSDS | msds/88667_1_13333_86_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-4-fluorobenzylAlcohol | 208186-84-9 | 2A-9088661 |
| 3-Biphenyl-4-yl-3-oxo-propionicacidethylester | 57477-98-2 | 2A-9088662 |
| 3-Biphenyl-2-yl-3-oxo-propionicacidmethylester | 677326-71-5 | 2A-9088663 |
| 3-Biphenyl-3-yl-3-oxo-propionicacidmethylester | 677326-70-4 | 2A-9088665 |
| 3-Biphenyl-4-yl-3-oxo-propionicacidmethylester | 56216-10-5 | 2A-9088666 |
| 1,3-Bis(carbomethoxy)tetramethyldisiloxane | 204641-76-9 | 2A-9088669 |
| 2,7-Bis-ethoxycarbonyloctanedioicaciddiethylester | 5394-84-3 | 2A-9088672 |
| 3-(2-Bromophenyl)-3-oxo-propionicacidmethylester | 294881-08-6 | 2A-9088675 |
| 3-(3-Bromo-phenyl)-3-oxo-propionicacidmethylester | 294881-10-0 | 2A-9088677 |
| 3-(4-Bromo-phenyl)-3-oxo-propionicacidmethylester | 126629-81-0 | 2A-9088679 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA