
CAS Number294881-10-0
SynonymsBenzenepropanoic acid, 3-bromo-β-oxo-, methyl ester; Methyl 3-(3-bromophenyl)-3-oxopropanoate; 3-Bromo-b-oxo-benzenepropanoic acid methyl ester
Molecular FormulaC18H13BrN2O
Molecular Weight353.221
Density1.5±0.1 g/cm3
Boiling Point314.2±22.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 294881-10-0 |
| Catalog No. | 2A-9088677 |
| Chinese Name | 3-(3-溴苯基)-3-氧丙酸甲酯 |
| Synonyms | Benzenepropanoic acid, 3-bromo-β-oxo-, methyl ester; Methyl 3-(3-bromophenyl)-3-oxopropanoate; 3-Bromo-b-oxo-benzenepropanoic acid methyl ester |
| Molecular Formula | C18H13BrN2O |
| Molecular Weight | 353.221 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 314.2±22.0 °C at 760 mmHg |
| HTC | 2918300090 |
| MDL Number | MFCD01162235 |
| SMILES | COC(=O)CC(=O)c1cccc(Br)c1 |
| InChI Key | ARQSZPQWKHRYTH-UHFFFAOYSA-N |
| MSDS | msds/88677_1_294881_10_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Biphenyl-4-yl-3-oxo-propionicacidmethylester | 56216-10-5 | 2A-9088666 |
| (Biphenyl-4-yloxy)aceticacid | 13333-86-3 | 2A-9088667 |
| 1,3-Bis(carbomethoxy)tetramethyldisiloxane | 204641-76-9 | 2A-9088669 |
| 2,7-Bis-ethoxycarbonyloctanedioicaciddiethylester | 5394-84-3 | 2A-9088672 |
| 3-(2-Bromophenyl)-3-oxo-propionicacidmethylester | 294881-08-6 | 2A-9088675 |
| 3-(4-Bromo-phenyl)-3-oxo-propionicacidmethylester | 126629-81-0 | 2A-9088679 |
| 4-tert-Butyl-4'-fluorobenzhydrol | 596812-34-9 | 2A-9088680 |
| 7-(3-Bromopropoxy)-chromen-2-one | 69150-28-3 | 2A-9088681 |
| 4-Bromo-3-sulfamoyl-benzoicacid | 59815-19-9 | 2A-9088683 |
| 3,3'-Dimethoxy-3''-fluorotritylalcohol | 845790-70-7 | 2A-9088686 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA