CAS Number677326-79-3
Synonyms[1,1'-Biphenyl]-3-propanoic acid, β-oxo-, ethyl ester; 3-Biphenyl-3-yl-3-oxopropionic acid ethyl ester; ethyl 3-(3-biphenyl)-3-oxopropanoate; Ethyl 3-(biphenyl-3-yl)-3-oxopropanoate; Ethyl 3-(3-biphenylyl)-3-oxopropanoate
Molecular FormulaC21H16N2O4
Molecular Weight360.373
Density1.1±0.1 g/cm3
Boiling Point410.1±28.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 677326-79-3 |
| Catalog No. | 2A-9088660 |
| Chinese Name | 3-联苯-3-氧丙酸乙酯 |
| Synonyms | [1,1'-Biphenyl]-3-propanoic acid, β-oxo-, ethyl ester; 3-Biphenyl-3-yl-3-oxopropionic acid ethyl ester; ethyl 3-(3-biphenyl)-3-oxopropanoate; Ethyl 3-(biphenyl-3-yl)-3-oxopropanoate; Ethyl 3-(3-biphenylyl)-3-oxopropanoate |
| Molecular Formula | C21H16N2O4 |
| Molecular Weight | 360.373 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 410.1±28.0 °C at 760 mmHg |
| HTC | 2918300090 |
| MDL Number | MFCD00706442 |
| SMILES | CCOC(=O)CC(=O)c1cccc(-c2ccccc2)c1 |
| InChI Key | GGPCOTQUFRKOJH-UHFFFAOYSA-N |
| MSDS | msds/88660_1_677326_79_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hexylmalonicacid | 3974-36-5 | 2A-9088650 |
| 3-(4-Bromophenoxymethyl)benzoicacid | 380173-56-8 | 2A-9088653 |
| 3-(Pyrazol-1-yl)-1-propanol | 180741-37-1 | 2A-9088655 |
| 4-(2-Bromophenoxymethyl)benzoicacid | 364610-26-4 | 2A-9088656 |
| 4-(4-Bromophenoxymethyl)benzoicacid | 364623-84-7 | 2A-9088658 |
| 2-Chloro-4-fluorobenzylAlcohol | 208186-84-9 | 2A-9088661 |
| 3-Biphenyl-4-yl-3-oxo-propionicacidethylester | 57477-98-2 | 2A-9088662 |
| 3-Biphenyl-2-yl-3-oxo-propionicacidmethylester | 677326-71-5 | 2A-9088663 |
| 3-Biphenyl-3-yl-3-oxo-propionicacidmethylester | 677326-70-4 | 2A-9088665 |
| 3-Biphenyl-4-yl-3-oxo-propionicacidmethylester | 56216-10-5 | 2A-9088666 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS